CAS 51012-62-5

2-bromo-1-[4-(propan-2-yl)phenyl]ethanone

Description:

2-bromo-1-[4-(propan-2-yl)phenyl]ethanone, with the CAS number 51012-62-5, is an organic compound characterized by its structure, which includes a bromine atom, a ketone functional group, and an isopropyl-substituted phenyl group. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The ketone group contributes to its potential as a precursor in various synthetic pathways, making it valuable in organic synthesis. Additionally, the presence of the isopropyl group can influence its solubility and stability in different solvents. The compound may exhibit biological activity, which could be of interest in medicinal chemistry, although specific biological properties would require further investigation. Overall, 2-bromo-1-[4-(propan-2-yl)phenyl]ethanone is a versatile compound with applications in chemical research and synthesis.

Formula: C₁₁H₁₃BrO

InChI: InChI=1/C11H13BrO/c1-8(2)9-3-5-10(6-4-9)11(13)7-12/h3-6,8H,7H2,1-2H3

SMILES: CC(C)c1ccc(cc1)C(=O)CBr

Synonyms:

• Ethanone, 2-Bromo-1-[4-(1-Methylethyl)Phenyl]-

2-Bromo-4’-isopropylacetophenone

Controlled Product

CAS: 51012-62-5

Stability Moisture Sensitive
Applications 2-Bromo-4’-isopropylacetophenone (cas# 51012-62-5) is a compound useful in organic synthesis.

Formula: C₁₁H₁₃BrO

Color and Shape: Neat

Molecular weight: 241.124

Ref: TR-B684650