CymitQuimica logo

CAS 51015-29-3

:

6-Methyl-1-tetralone

Description:
6-Methyl-1-tetralone, with the CAS number 51015-29-3, is an organic compound belonging to the class of ketones. It features a bicyclic structure, specifically a tetralone, which consists of a fused cyclohexane and cyclopentane ring system. The presence of a methyl group at the 6-position of the tetralone framework contributes to its unique chemical properties. This compound is typically characterized by its relatively low molecular weight and moderate polarity, which influences its solubility in various organic solvents. 6-Methyl-1-tetralone may exhibit interesting reactivity due to the presence of the carbonyl group, making it a potential candidate for various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, it may serve as an intermediate in the synthesis of more complex organic molecules or as a building block in medicinal chemistry. Its physical properties, such as boiling point and melting point, can vary based on purity and specific conditions, but it is generally stable under standard laboratory conditions.
Formula:C11H12O
InChI:InChI=1S/C11H12O/c1-8-5-6-10-9(7-8)3-2-4-11(10)12/h5-7H,2-4H2,1H3
InChI key:InChIKey=FPOGGJAFMWYNLI-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(C)=CC2)CCC1
Synonyms:
  • 1(2H)-Naphthalenone, 3,4-dihydro-6-methyl-
  • 3,4-Dihydro-6-methyl-1(2H)-naphthalenone
  • 6-Methyl-1-tetralone
  • 6-Methyl-α-tetralone
  • 6-methyl-3,4-dihydronaphthalen-1(2H)-one
  • 3,4-Dihydro-6-methylnaphthalen-1(2H)-one
Found 4 products.