CAS 51018-80-5
:α-Ethyl-α-methylbenzeneacetic acid
Description:
α-Ethyl-α-methylbenzeneacetic acid, also known by its CAS number 51018-80-5, is an organic compound characterized by its structure, which includes a benzene ring substituted with both ethyl and methyl groups, along with a carboxylic acid functional group. This compound typically exhibits properties associated with aromatic acids, such as moderate solubility in organic solvents and limited solubility in water due to its hydrophobic hydrocarbon chains. The presence of the carboxylic acid group imparts acidic characteristics, allowing it to participate in various chemical reactions, including esterification and neutralization. Its molecular structure suggests potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Additionally, the compound may exhibit specific reactivity patterns typical of substituted aromatic acids, such as electrophilic aromatic substitution. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H14O2
InChI:InChI=1S/C11H14O2/c1-3-11(2,10(12)13)9-7-5-4-6-8-9/h4-8H,3H2,1-2H3,(H,12,13)
InChI key:InChIKey=IDZLDUPVMGWZLD-UHFFFAOYSA-N
SMILES:C(C(O)=O)(CC)(C)C1=CC=CC=C1
Synonyms:- NSC 133936
- DL-α-Ethyl-α-methylbenzeneacetic acid
- Benzeneacetic acid, α-ethyl-α-methyl-
- Benzeneacetic acid, α-ethyl-α-methyl-, (±)-
- α-Ethyl-α-methylbenzeneacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-Methyl-2-phenylbutanoic acid
CAS:2-Methyl-2-phenylbutanoic acid is a molecule with a formula of C8H14O2. It has one hydroxyl group and one acceptor, which are the two functional groups that have an effect on the molecular electrostatic potential. The molecule also has a butyric acid group, which is a short-chain fatty acid. 2-Methyl-2-phenylbutanoic acid is an anticomplement agent and is used in research to study the complement system's role in inflammation and tissue damage. The molecule's structure can be described by its functional groups, which are antiinflammatory in nature.Formula:C11H14O2Purity:Min. 95%Molecular weight:178.23 g/mol
