
CAS 51020-36-1
:7-[[(1R,4aS,6R,8aR)-1,4,4a,5,6,7,8,8a-Octahydro-6-hydroxy-2,5,5,8a-tetramethyl-1-naphthalenyl]methoxy]-2H-1-benzopyran-2-one
Description:
The chemical substance known as "7-[[(1R,4aS,6R,8aR)-1,4,4a,5,6,7,8,8a-Octahydro-6-hydroxy-2,5,5,8a-tetramethyl-1-naphthalenyl]methoxy]-2H-1-benzopyran-2-one," with the CAS number 51020-36-1, is a complex organic compound characterized by its polycyclic structure, which includes a benzopyran moiety and a naphthalene derivative. This compound features multiple chiral centers, contributing to its stereochemical complexity. It is known for its potential biological activities, which may include antioxidant properties and interactions with various biological targets. The presence of hydroxyl and methoxy functional groups enhances its reactivity and solubility in organic solvents. Additionally, the compound's structural features suggest it may be of interest in medicinal chemistry and natural product research. Its specific applications and efficacy would depend on further studies, including pharmacological evaluations and toxicity assessments. Overall, this compound exemplifies the intricate nature of organic molecules and their potential roles in various scientific fields.
Formula:C24H30O4
InChI:InChI=1S/C24H30O4/c1-15-5-9-20-23(2,3)21(25)11-12-24(20,4)18(15)14-27-17-8-6-16-7-10-22(26)28-19(16)13-17/h5-8,10,13,18,20-21,25H,9,11-12,14H2,1-4H3/t18-,20-,21-,24+/m1/s1
InChI key:InChIKey=MCTDXPDDZLFJHR-XLRKYUMYSA-N
SMILES:C[C@@]12[C@](CC=C(C)[C@H]1COC=3C=C4C(=CC3)C=CC(=O)O4)(C(C)(C)[C@H](O)CC2)[H]
Synonyms:- Fezelol
- 7-[[(1R,4aS,6R,8aR)-1,4,4a,5,6,7,8,8a-Octahydro-6-hydroxy-2,5,5,8a-tetramethyl-1-naphthalenyl]methoxy]-2H-1-benzopyran-2-one
- Moschatol
- 2H-1-Benzopyran-2-one, 7-[[(1R,4aS,6R,8aR)-1,4,4a,5,6,7,8,8a-octahydro-6-hydroxy-2,5,5,8a-tetramethyl-1-naphthalenyl]methoxy]-
- 2H-1-Benzopyran-2-one, 7-[(1,4,4a,5,6,7,8,8a-octahydro-6-hydroxy-2,5,5,8a-tetramethyl-1-naphthalenyl)methoxy]-, [1R-(1α,4aβ,6α,8aα)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Fezelol
CAS:Fezelol is a sesquiterpene coumarin isolated from the fruits of Ferula badrakema.Formula:C24H30O4Color and Shape:SolidMolecular weight:382.49
