CAS 51020-86-1
:(-)-Licarin A
Description:
(-)-Licarin A, with the CAS number 51020-86-1, is a naturally occurring alkaloid primarily derived from the plant species of the genus Licaria. This compound is characterized by its complex molecular structure, which includes multiple chiral centers, contributing to its specific stereochemistry. (-)-Licarin A exhibits notable biological activities, including potential anti-inflammatory and anti-cancer properties, making it a subject of interest in pharmacological research. Its solubility profile typically indicates moderate solubility in organic solvents, while its stability can be influenced by environmental factors such as light and temperature. The compound's interactions with biological systems are often mediated through its ability to bind to specific receptors or enzymes, which can lead to various physiological effects. As with many natural products, the extraction and purification processes are crucial for obtaining (-)-Licarin A in a form suitable for further study or application. Overall, (-)-Licarin A represents a significant area of interest in natural product chemistry and medicinal research.
Formula:C20H22O4
InChI:InChI=1S/C20H22O4/c1-5-6-13-9-15-12(2)19(24-20(15)18(10-13)23-4)14-7-8-16(21)17(11-14)22-3/h5-12,19,21H,1-4H3/b6-5+/t12-,19-/m1/s1
InChI key:InChIKey=ITDOFWOJEDZPCF-OTBILJLCSA-N
SMILES:O(C)C1=C2C([C@@H](C)[C@@H](O2)C3=CC(OC)=C(O)C=C3)=CC(/C=C/C)=C1
Synonyms:- (-)-Licarin A
- 2,3-(2R,3R)-Dihydro-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-3-methyl-5-(E)-propenylbenzofuran
- 4-[(2R,3R)-2,3-Dihydro-7-methoxy-3-methyl-5-(1E)-1-propen-1-yl-2-benzofuranyl]-2-methoxyphenol
- NSC 370989
- Phenol, 4-[(2R,3R)-2,3-dihydro-7-methoxy-3-methyl-5-(1E)-1-propenyl-2-benzofuranyl]-2-methoxy-
- phenol, 4-[(2R,3R)-2,3-dihydro-7-methoxy-3-methyl-5-[(1E)-1-propen-1-yl]-2-benzofuranyl]-2-methoxy-
- 4-[(2S)-2,3-Dihydro-7-methoxy-3β-methyl-5-[(E)-1-propenyl]benzofuran-2-yl]-2-methoxyphenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Phenol,4-[(2R,3R)-2,3-dihydro-7-methoxy-3-methyl-5-(1E)-1-propenyl-2-benzofuranyl]-2-methoxy-
CAS:Formula:C20H22O4Purity:98%Color and Shape:SolidMolecular weight:326.3863Licarin A
CAS:Licarin A is a natural anti-inflammatory lignan that inhibits PKCα/βII and p38 MAPK pathways, thereby decreasing TNF-α and prostaglandin D2 (PGD2)and COX-2.
Formula:C20H22O4Purity:99.5%Color and Shape:SolidMolecular weight:326.392-Methoxy-4-((2R,3R)-7-methoxy-3-methyl-5-((E)-prop-1-en-1-yl)-2,3-dihydrobenzofuran-2-yl)phenol
CAS:2-Methoxy-4-((2R,3R)-7-methoxy-3-methyl-5-((E)-prop-1-en-1-yl)-2,3-dihydrobenzofuran-2-yl)phenolPurity:98%Molecular weight:326.39g/molLicarin A
CAS:Licarin A is a homolog of protocatechuic acid and has been shown to have antimicrobial activity against bacteria and fungi. It binds to the hydroxyl group of the ATP synthase, which is required for the production of ATP. Licarin A inhibits mitochondrial membrane potential and increases the level of reactive oxygen species, leading to cell death. The effect on mitochondria may be due to its ability to inhibit the synthesis of fatty acids in mitochondria. Licarin A also has an anti-inflammatory effect by inhibiting tumor necrosis factor-α (TNF-α) production in HL-60 cells and mutant melanoma cells.Formula:C20H22O4Purity:Min. 97 Area-%Color and Shape:PowderMolecular weight:326.39 g/mol





