CAS 51020-87-2: (-)-Licarin-B
Description:(-)-Licarin-B, with the CAS number 51020-87-2, is a naturally occurring compound classified as a flavonoid. It is primarily derived from various plant sources, particularly those in the genus Licaria. This compound exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. (-)-Licarin-B is characterized by its specific stereochemistry, which contributes to its biological activity and interaction with biological systems. The compound typically appears as a yellowish solid and is soluble in organic solvents, reflecting its lipophilic nature. Its structural features include multiple hydroxyl groups and a flavone backbone, which are common in flavonoids and contribute to their reactivity and biological functions. Research into (-)-Licarin-B continues to explore its potential therapeutic applications, particularly in the fields of medicine and nutrition, highlighting the importance of natural products in drug discovery and development.
Formula:C20H20O4
InChI:InChI=1S/C20H20O4/c1-4-5-13-8-15-12(2)19(24-20(15)18(9-13)21-3)14-6-7-16-17(10-14)23-11-22-16/h4-10,12,19H,11H2,1-3H3/b5-4+/t12-,19-/m1/s1
InChI key:InChIKey=DMMQXURQRMNSBM-YZAYTREXSA-N
SMILES:O(C=1C=C(C=CC)C=C2C1OC(C3=CC=C4OCOC4=C3)C2C)C
- Synonyms:
- 1,3-Benzodioxole, 5-[(2R,3R)-2,3-dihydro-7-methoxy-3-methyl-5-(1E)-1-propen-1-yl-2-benzofuranyl]-
- 1,3-Benzodioxole, 5-[(2R,3R)-2,3-dihydro-7-methoxy-3-methyl-5-(1E)-1-propenyl-2-benzofuranyl]-
- 5-((2R,3R)-2,3-Dihydro-7-methoxy-3-methyl-5-(1E)-1-propenyl-2-benzofuranyl)-1,3-benzodioxole
- 5-[(2R,3R)-2,3-Dihydro-7-methoxy-3-methyl-5-(1E)-1-propen-1-yl-2-benzofuranyl]-1,3-benzodioxole
- 5-{(2R,3R)-7-methoxy-3-methyl-5-[(1E)-prop-1-en-1-yl]-2,3-dihydro-1-benzofuran-2-yl}-1,3-benzodioxole
- 5-{(3S)-7-methoxy-3-methyl-5-[(1E)-prop-1-en-1-yl]-2,3-dihydro-1-benzofuran-2-yl}-1,3-benzodioxole
- NSC 370990
- Licarin B
- (-)-Licarin-B
