CAS 51020-87-2
:(-)-Licarin-B
Description:
(-)-Licarin-B, with the CAS number 51020-87-2, is a naturally occurring compound classified as a flavonoid. It is primarily derived from various plant sources, particularly those in the genus Licaria. This compound exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. (-)-Licarin-B is characterized by its specific stereochemistry, which contributes to its biological activity and interaction with biological systems. The compound typically appears as a yellowish solid and is soluble in organic solvents, reflecting its lipophilic nature. Its structural features include multiple hydroxyl groups and a flavone backbone, which are common in flavonoids and contribute to their reactivity and biological functions. Research into (-)-Licarin-B continues to explore its potential therapeutic applications, particularly in the fields of medicine and nutrition, highlighting the importance of natural products in drug discovery and development.
Formula:C20H20O4
InChI:InChI=1S/C20H20O4/c1-4-5-13-8-15-12(2)19(24-20(15)18(9-13)21-3)14-6-7-16-17(10-14)23-11-22-16/h4-10,12,19H,11H2,1-3H3/b5-4+/t12-,19-/m1/s1
InChI key:InChIKey=DMMQXURQRMNSBM-YZAYTREXSA-N
SMILES:O(C)C1=C2C([C@@H](C)[C@@H](O2)C=3C=C4C(=CC3)OCO4)=CC(/C=C/C)=C1
Synonyms:- 1,3-Benzodioxole, 5-[(2R,3R)-2,3-dihydro-7-methoxy-3-methyl-5-(1E)-1-propen-1-yl-2-benzofuranyl]-
- 1,3-Benzodioxole, 5-[(2R,3R)-2,3-dihydro-7-methoxy-3-methyl-5-(1E)-1-propenyl-2-benzofuranyl]-
- 5-((2R,3R)-2,3-Dihydro-7-methoxy-3-methyl-5-(1E)-1-propenyl-2-benzofuranyl)-1,3-benzodioxole
- 5-[(2R,3R)-2,3-Dihydro-7-methoxy-3-methyl-5-(1E)-1-propen-1-yl-2-benzofuranyl]-1,3-benzodioxole
- 5-{(2R,3R)-7-methoxy-3-methyl-5-[(1E)-prop-1-en-1-yl]-2,3-dihydro-1-benzofuran-2-yl}-1,3-benzodioxole
- 5-{(3S)-7-methoxy-3-methyl-5-[(1E)-prop-1-en-1-yl]-2,3-dihydro-1-benzofuran-2-yl}-1,3-benzodioxole
- NSC 370990
- Licarin B
- (-)-Licarin-B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Licarin B
CAS:1.(-)-Licarin B (Licarine B) has anti-mycobacterial activity.Formula:C20H20O4Purity:99.82% - ≥95%Color and Shape:SolidMolecular weight:324.37(-)-Licarin B
CAS:Licarin B is a natural product that has been shown to have significant cytotoxicity against 3t3-L1 preadipocytes and HL-60 cells. This compound also induces apoptosis in mutant melanoma cells and inhibits the growth of wild-type cancer cells. Licarin B is found in plants from the families of Acanthaceae, Lamiaceae, Myrtaceae, and Rutaceae. It has not been determined what licarin B's chemical structure is, but it has been identified as an acetate extract from these plants. Licarin B's biological properties may be due to its ability to inhibit fatty acid synthase, which regulates fat accumulation in cells.Formula:C20H20O4Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:324.37 g/mol






