CAS 51027-02-2

thymolphthalein monophosphate ammonium

Description:

Thymolphthalein monophosphate ammonium, with the CAS number 51027-02-2, is a chemical compound that serves as a pH indicator and is often utilized in biochemical applications. It is derived from thymolphthalein, a well-known pH indicator that changes color in response to pH variations, typically transitioning from colorless to blue in alkaline conditions. The monophosphate form indicates the presence of a phosphate group, which can enhance its solubility and stability in aqueous solutions. As an ammonium salt, it may exhibit properties typical of ammonium compounds, such as solubility in water and potential interactions with biological systems. This compound is often used in laboratory settings for titrations and as a reagent in various chemical assays. Its characteristics include a specific pH range for color change, making it valuable for monitoring pH levels in different environments. Overall, thymolphthalein monophosphate ammonium is a versatile compound with applications in both research and industrial settings.

Formula: C₂₈H₃₇N₂O₇P

InChI: InChI=1/C28H31O7P.2H3N/c1-15(2)20-13-23(17(5)11-25(20)29)28(22-10-8-7-9-19(22)27(30)34-28)24-14-21(16(3)4)26(12-18(24)6)35-36(31,32)33;;/h7-16,29H,1-6H3,(H2,31,32,33);2*1H3

SMILES: CC(C)c1cc(c(C)cc1O)C1(c2ccccc2C(=O)O1)c1cc(C(C)C)c(cc1C)OP(=O)(O)O.N.N

Synonyms:

• Thymolphthaleinphosphoric acid diammonium salt
• Diammonium 4-{1-[4-Hydroxy-2-Methyl-5-(1-Methylethyl)Phenyl]-3-Oxo-1,3-Dihydro-2-Benzofuran-1-Yl}-5-Methyl-2-(1-Methylethyl)Phenyl Phosphate