CAS 51037-51-5

1-(4-fluorophenyl)-2-hydroxy-4-[4-(2-methoxyphenyl)piperazin-1-yl]butan-1-one

Description:

1-(4-fluorophenyl)-2-hydroxy-4-[4-(2-methoxyphenyl)piperazin-1-yl]butan-1-one, with CAS number 51037-51-5, is a synthetic organic compound characterized by its complex molecular structure, which includes a butanone backbone, a hydroxy group, and a piperazine moiety. This compound features a fluorophenyl group and a methoxyphenyl substituent, contributing to its potential pharmacological properties. It is typically classified as a psychoactive substance, often investigated for its effects on neurotransmitter systems, particularly in relation to serotonin and dopamine pathways. The presence of the hydroxy group suggests it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. Additionally, the piperazine ring is known for its role in enhancing the bioactivity of various compounds, making this substance of interest in medicinal chemistry. Its specific applications and effects would depend on ongoing research, particularly in the fields of neuropharmacology and drug development. As with many synthetic compounds, safety and regulatory considerations are paramount in its handling and use.

Formula: C₂₁H₂₅FN₂O₃

InChI: InChI=1/C21H25FN2O3/c1-27-20-5-3-2-4-18(20)24-14-12-23(13-15-24)11-10-19(25)21(26)16-6-8-17(22)9-7-16/h2-9,19,25H,10-15H2,1H3

SMILES: COc1ccccc1N1CCN(CCC(C(=O)c2ccc(cc2)F)O)CC1