CAS 51037-74-2

2-Bromo-4-chloro-1-(4-fluorophenyl)-1-butanone

Description:

2-Bromo-4-chloro-1-(4-fluorophenyl)-1-butanone, with the CAS number 51037-74-2, is an organic compound characterized by its halogenated structure, which includes bromine, chlorine, and fluorine substituents. This compound features a butanone backbone, indicating the presence of a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of multiple halogens can enhance its biological activity and influence its physical properties, such as solubility and volatility. Typically, compounds like this may exhibit significant polar characteristics due to the electronegative halogens, which can affect their interactions with other molecules. Additionally, the presence of the 4-fluorophenyl group suggests potential applications in pharmaceuticals or agrochemicals, as halogenated aromatic compounds are often explored for their biological activity. Overall, 2-Bromo-4-chloro-1-(4-fluorophenyl)-1-butanone is a versatile compound that may serve as an intermediate in various chemical reactions or as a building block in the synthesis of more complex molecules.

Formula: C₁₀H₉BrClFO

InChI: InChI=1S/C10H9BrClFO/c11-9(5-6-12)10(14)7-1-3-8(13)4-2-7/h1-4,9H,5-6H2

InChI key: InChIKey=LTDBFRKGDVLQLR-UHFFFAOYSA-N

SMILES: C(C(CCCl)Br)(=O)C1=CC=C(F)C=C1

Synonyms:

• 1-Butanone, 2-bromo-4-chloro-1-(4-fluorophenyl)-
• 2-Bromo-4-Chloro-1-(4-Fluorophenyl)Butan-1-One
• 2-Bromo-4-chloro-1-(4-fluorophenyl)-1-butanone