CAS 51053-36-2
:Dermostatin A
Description:
Dermostatin A is a bioactive compound classified as a cyclic peptide, originally isolated from the marine organism *Dermatocarpon miniatum*. This substance exhibits notable biological activities, particularly in the realm of immunomodulation and potential anti-inflammatory effects. Dermostatin A is characterized by its unique cyclic structure, which contributes to its stability and biological activity. The compound has garnered interest in pharmaceutical research due to its potential therapeutic applications, including its role in modulating immune responses. Additionally, Dermostatin A has been studied for its effects on cell signaling pathways, which may have implications in cancer research and treatment. Its specific interactions at the molecular level are still under investigation, but its unique properties make it a subject of interest in medicinal chemistry and drug development. As with many natural products, the extraction and synthesis of Dermostatin A pose challenges, but advancements in synthetic methodologies may enhance its availability for research and therapeutic use.
Formula:C40H64O11
InChI:InChI=1/C40H64O11/c1-27(2)40-28(3)18-19-30(41)20-31(42)21-32(43)22-33(44)23-34(45)24-35(46)25-36(47)26-38(49)29(4)37(48)16-14-12-10-8-6-5-7-9-11-13-15-17-39(50)51-40/h5-15,17-19,27-38,40-49H,16,20-26H2,1-4H3
Synonyms:- Oxacyclohexatriaconta-3,5,7,9,11,13,33-heptaen-2-one, 16,18,20,22,24,26,28,30,32-nonahydroxy-17,35-dimethyl-36-(1-methylethyl)-, (3E,5E,7E,9E,11E,13E,16S,17S,18R,20R,22R,24S,26S,28R,30R,32R,33E,35S,36S)-
- Dermostatin A
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dermostatin A
CAS:Dermostatin A is a polyene antibiotic with antifungal properties suitable for studying fungal infections.Formula:C40H64O11Color and Shape:SolidMolecular weight:720.93
