CAS 51063-97-9: (±)-1,2-Distearin
Description:(±)-1,2-Distearin, with the CAS number 51063-97-9, is a diacylglycerol that is primarily composed of two stearic acid molecules esterified to a glycerol backbone. This compound is a type of triglyceride, specifically a distearate, and is characterized by its high melting point due to the long carbon chain of the stearic acid moieties. It is typically a solid at room temperature and is insoluble in water but soluble in organic solvents such as ethanol and chloroform. (±)-1,2-Distearin is often used in food and cosmetic formulations as an emulsifier, thickening agent, or stabilizer. Its properties make it valuable in various applications, including pharmaceuticals and biochemistry, where it can serve as a model compound for studying lipid behavior. Additionally, it can undergo hydrolysis to release stearic acid and glycerol, which are important in various metabolic processes. Safety data indicates that it is generally regarded as safe for use in food and cosmetic products, although standard handling precautions should be observed.
Formula:C39H76O5
InChI:InChI=1S/C39H76O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-36-37(35-40)44-39(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h37,40H,3-36H2,1-2H3
InChI key:InChIKey=UHUSDOQQWJGJQS-UHFFFAOYSA-N
SMILES:O=C(OCC(OC(=O)CCCCCCCCCCCCCCCCC)CO)CCCCCCCCCCCCCCCCC
- Synonyms:
- (RS)-1,2-Distearin
- (±)-1,2-Distearin
- (±)-1,2-Distearoylglycerol
- 1,2-Di-O-stearoylglycerin
- 1,2-Dioctadecanoyl-rac-glycerol
- 1,2-Distearoyl-rac-glycerol
- Glycerol 1,2-distearate
- Glyceryl 1,2-distearate
- NSC 75181
- Octadecanoic acid, 1,1′-[1-(hydroxymethyl)-1,2-ethanediyl] ester
- See more synonyms
- Octadecanoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester
- rac-1,2-Distearoylglycerol