CAS 51068-75-8

2-oxo-2-piperidin-1-ylethanol

Description:

2-Oxo-2-piperidin-1-ylethanol, with the CAS number 51068-75-8, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a ketone functional group (the "2-oxo" part) and a hydroxyl group (the "ethanol" part), indicating that it has both carbonyl and alcohol functionalities. The presence of the piperidine moiety suggests potential applications in medicinal chemistry, as piperidine derivatives are often found in various pharmaceuticals. The compound is likely to exhibit polar characteristics due to the hydroxyl group, which can engage in hydrogen bonding, influencing its solubility in polar solvents. Additionally, the structural features may contribute to its reactivity, making it a candidate for further chemical transformations. Overall, 2-oxo-2-piperidin-1-ylethanol is of interest in synthetic organic chemistry and may have implications in drug development or as an intermediate in chemical synthesis.

Formula: C₇H₁₃NO₂

InChI: InChI=1/C7H13NO2/c9-6-7(10)8-4-2-1-3-5-8/h9H,1-6H2

SMILES: C1CCN(CC1)C(=O)CO

Synonyms:

• 1-Piperidineethanol, .beta.-oxo-

2-oxo-2-piperidin-1-ylethanol

CAS: 51068-75-8

2-Oxo-2-piperidin-1-ylethanol (OPAH) is an alkynyl with a benzene ring and a pyridyl. It can be synthesized by cross-linking the alkylene, which is unsaturated, to an alkenyl. The carbamoyl group can be attached to the amide or alkyl of the alkynyl. The cycloalkyl is attached to the phenyl at its 1-4 position.

Formula: C₇H₁₃NO₂

Purity: Min. 95%

Molecular weight: 143.18 g/mol

Ref: 3D-BCA06875