CAS 51069-26-2

methyl 1-azabicyclo[2.2.2]octane-4-carboxylate

Description:

Methyl 1-azabicyclo[2.2.2]octane-4-carboxylate, identified by its CAS number 51069-26-2, is a bicyclic compound featuring a nitrogen atom within its bicyclic structure. This compound is characterized by its azabicyclic framework, which consists of a bicyclo[2.2.2]octane core with a carboxylate ester functional group. The presence of the nitrogen atom contributes to its potential as a pharmacophore, making it of interest in medicinal chemistry. The methyl ester group enhances its solubility and reactivity, which can be advantageous in various chemical reactions and applications. Typically, compounds of this nature exhibit moderate to high stability under standard conditions, but their reactivity can vary depending on the substituents and the specific environment. Methyl 1-azabicyclo[2.2.2]octane-4-carboxylate may also exhibit biological activity, making it a candidate for further research in drug development and synthesis. Overall, its unique structural features and functional groups contribute to its potential utility in various chemical and pharmaceutical applications.

Formula: C₉H₁₅NO₂

InChI: InChI=1/C9H15NO2/c1-12-8(11)9-2-5-10(6-3-9)7-4-9/h2-7H2,1H3

SMILES: COC(=O)C12CCN(CC1)CC2

Methyl quinuclidine-4-carboxylate

CAS: 51069-26-2

Formula: C₉H₁₅NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 169.2209

Ref: IN-DA00DJOV

Methyl quinuclidine-4-carboxylate

CAS: 51069-26-2

Methyl quinuclidine-4-carboxylate

Purity: 98%

Molecular weight: 169.22g/mol

Ref: 54-OR88444

Methyl 4-Quinuclidinecarboxylate

Controlled Product

CAS: 51069-26-2

Applications Methyl 4-Quinuclidinecarboxylate is a reactant used in the synthesis ofoxadiazole and indolyloxadiazole 5-HT3 hydroxytryptamine) antagonists.
References Swain, C.J., et. al.: J. med. Chem., 34, 140 (1991)

Formula: C₉H₁₅NO₂

Color and Shape: Neat

Molecular weight: 169.221

Ref: TR-M327220

Methyl quinuclidine-4-carboxylate

CAS: 51069-26-2

Purity: 98%

Molecular weight: 169.223999

Ref: 10-F622591

Methyl 1-azabicyclo[2.2.2]octane-4-carboxylate

CAS: 51069-26-2

Versatile small molecule scaffold

Formula: C₉H₁₅NO₂

Purity: Min. 95%

Molecular weight: 169.22 g/mol

Ref: 3D-BCA06926