
CAS 5107-01-7
:Alloclamide hydrochloride
Description:
Alloclamide hydrochloride is a chemical compound that belongs to the class of amides, specifically characterized by its hydrochloride salt form. It is primarily recognized for its potential pharmacological applications, particularly in the field of medicine. The compound exhibits properties typical of amides, such as the presence of a carbonyl group (C=O) adjacent to a nitrogen atom (N), which contributes to its reactivity and interaction with biological systems. Alloclamide hydrochloride is soluble in water, which enhances its bioavailability for therapeutic use. Its molecular structure allows for specific interactions with biological targets, making it of interest in drug development. The compound's safety profile, efficacy, and mechanism of action are subjects of ongoing research, as with many pharmaceutical agents. As with any chemical substance, proper handling and storage conditions are essential to maintain its stability and effectiveness. Overall, Alloclamide hydrochloride represents a significant compound in medicinal chemistry, warranting further exploration for its therapeutic potential.
Formula:C16H23ClN2O2·ClH
InChI:InChI=1S/C16H23ClN2O2.ClH/c1-4-11-21-15-12-13(17)7-8-14(15)16(20)18-9-10-19(5-2)6-3;/h4,7-8,12H,1,5-6,9-11H2,2-3H3,(H,18,20);1H
InChI key:InChIKey=QEWLHSNMEXFSCI-UHFFFAOYSA-N
SMILES:C(NCCN(CC)CC)(=O)C1=C(OCC=C)C=C(Cl)C=C1.Cl
Synonyms:- Benzamide, 2-(allyloxy)-4-chloro-N-[2-(diethylamino)ethyl]-, hydrochloride
- Benzamide, 2-(allyloxy)-4-chloro-N-[2-(diethylamino)ethyl]-, monohydrochloride
- Benzamide, 4-chloro-N-[2-(diethylamino)ethyl]-2-(2-propen-1-yloxy)-, hydrochloride (1:1)
- Benzamide, 4-chloro-N-[2-(diethylamino)ethyl]-2-(2-propenyloxy)-, monohydrochloride
- Hexacol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Alloclamide hydrochloride
CAS:<p>Alloclamide hydrochloride is a cough suppressant.</p>Formula:C16H24Cl2N2O2Color and Shape:SolidMolecular weight:347.28
