CAS 5107-12-0

N-(4-nitrobenzoyl)-6-aminohexanoic acid

Description:

N-(4-nitrobenzoyl)-6-aminohexanoic acid, with the CAS number 5107-12-0, is an organic compound characterized by its structure, which includes an amino acid backbone modified with a nitrobenzoyl group. This compound typically exhibits properties associated with both amino acids and aromatic compounds, including solubility in polar solvents due to the presence of the amino group and potential hydrophobic interactions from the aromatic nitrobenzoyl moiety. The nitro group introduces electron-withdrawing characteristics, which can influence the compound's reactivity and stability. It may participate in various chemical reactions, such as acylation or coupling reactions, making it useful in synthetic organic chemistry and bioconjugation applications. Additionally, the presence of the amino group allows for potential interactions with biological systems, suggesting possible applications in pharmaceuticals or biochemistry. Overall, N-(4-nitrobenzoyl)-6-aminohexanoic acid is a versatile compound with unique chemical properties that can be leveraged in various scientific fields.

Formula: C₃₀H₂₉N₃O₃

InChI: InChI=1/C30H29N3O3/c1-20(2)28(30(36)33-31-19-25-24-16-10-9-11-21(24)17-18-26(25)34)32-29(35)27(22-12-5-3-6-13-22)23-14-7-4-8-15-23/h3-20,27-28,31H,1-2H3,(H,32,35)(H,33,36)

SMILES: CC(C)C(C(=NNC=C1c2ccccc2C=CC1=O)O)N=C(C(c1ccccc1)c1ccccc1)O

Synonyms:

• N-[2-methyl-1-({2-[(2-oxonaphthalen-1(2H)-ylidene)methyl]hydrazino}carbonyl)propyl]-2,2-diphenylacetamide (non-preferred name)

6-[(4-Nitrophenyl)formamido]hexanoic acid

CAS: 5107-12-0

6-[(4-Nitrophenyl)formamido]hexanoic acid is an asymmetric molecule that differs from hexanoic acid by the presence of a dimer. It has been shown to form hydrogen bonds with amides and carboxylic acid groups. This compound can be used in the synthesis of other molecules, such as the propanoic acid and carboxylic acid.

Formula: C₁₃H₁₆N₂O₅

Purity: Min. 95%

Molecular weight: 280.28 g/mol

Ref: 3D-FAA10712