CAS 51070-58-7

N-(1,1-dioxidotetrahydrothiophen-3-yl)-N-methylglycine

Description:

N-(1,1-dioxidotetrahydrothiophen-3-yl)-N-methylglycine, with the CAS number 51070-58-7, is a chemical compound that features a unique structure combining a tetrahydrothiophene ring with a methylglycine moiety. This compound is characterized by the presence of a sulfur atom within the thiophene ring, which contributes to its distinctive chemical properties. The "1,1-dioxide" designation indicates that the compound has two oxygen atoms double-bonded to the sulfur, enhancing its reactivity and solubility in polar solvents. The methylglycine part of the molecule suggests potential applications in biological systems, as it is an amino acid derivative. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, N-(1,1-dioxidotetrahydrothiophen-3-yl)-N-methylglycine represents a class of compounds that may have diverse applications in pharmaceuticals and agrochemicals.

Formula: C₇H₁₃NO₄S

InChI: InChI=1/C7H13NO4S/c1-8(4-7(9)10)6-2-3-13(11,12)5-6/h6H,2-5H2,1H3,(H,9,10)

SMILES: CN(CC(=O)O)C1CCS(=O)(=O)C1

Synonyms:

• [(1,1-Dioxidotetrahydrothien-3-Yl)(Methyl)Amino]Acetic Acid
• Glycine, N-methyl-N-(tetrahydro-1,1-dioxido-3-thienyl)-
• N-(1,1-Dioxidotetrahydrothiophen-3-yl)-N-methylglycine

N-(1,1-Dioxidotetrahydro-3-thienyl)-N-methylglycine

CAS: 51070-58-7

Formula: C₇H₁₃NO₄S

Molecular weight: 207.2474

Ref: IN-DA00D9IB

[(1,1-Dioxo-tetrahydro-1lambda*6*-thiophen-3-yl)-methyl-amino]-acetic acid

CAS: 51070-58-7

Versatile small molecule scaffold

Formula: C₇H₁₃NO₄S

Purity: Min. 95%

Molecular weight: 207.24 g/mol

Ref: 3D-BCA07058