CAS 51070-62-3

4-{[(3R)-1,1-dioxidotetrahydrothiophen-3-yl]ammonio}butanoate

Description:

4-{[(3R)-1,1-dioxidotetrahydrothiophen-3-yl]ammonio}butanoate, with the CAS number 51070-62-3, is a chemical compound characterized by its unique structure that includes a tetrahydrothiophene ring and an ammonium group. This compound features a butanoate moiety, which contributes to its solubility and potential biological activity. The presence of the dioxo group indicates that it may exhibit redox properties, while the tetrahydrothiophene ring suggests potential interactions with biological systems, possibly influencing its pharmacological profile. The stereochemistry denoted by the (3R) configuration indicates a specific spatial arrangement of atoms, which can significantly affect the compound's reactivity and interactions with biological targets. Overall, this compound may have applications in medicinal chemistry, particularly in the development of therapeutics, due to its structural features that could facilitate interactions with various biological molecules. Further studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₈H₁₅NO₄S

InChI: InChI=1/C8H15NO4S/c10-8(11)2-1-4-9-7-3-5-14(12,13)6-7/h7,9H,1-6H2,(H,10,11)/t7-/m1/s1

InChI key: LOYVVYSXUYAYIB-UHFFFAOYSA-N

SMILES: C(CC(=O)O)CN[C@@H]1CCS(=O)(=O)C1