CAS 51071-75-1: 2,4,6-triphenylpyrylium hydrogensulfate
Description:2,4,6-Triphenylpyrylium hydrogensulfate is an organic compound characterized by its pyrylium cation structure, which consists of a six-membered aromatic ring containing one oxygen atom. This compound is notable for its bright color and strong electron-accepting properties, making it useful in various applications, including organic synthesis and as a dye. The presence of three phenyl groups attached to the pyrylium ring enhances its stability and solubility in organic solvents. As a hydrogensulfate salt, it is typically encountered in a crystalline form and can exhibit hygroscopic behavior, absorbing moisture from the environment. The compound is sensitive to light and can undergo photochemical reactions, which may lead to the formation of different products. Its reactivity is influenced by the electron-withdrawing nature of the pyrylium cation, allowing it to participate in electrophilic aromatic substitution reactions. Overall, 2,4,6-triphenylpyrylium hydrogensulfate is a versatile compound with significant implications in the fields of organic chemistry and materials science.
Formula:C23H18O5S
InChI:InChI=1/C23H17O.H2O4S/c1-4-10-18(11-5-1)21-16-22(19-12-6-2-7-13-19)24-23(17-21)20-14-8-3-9-15-20;1-5(2,3)4/h1-17H;(H2,1,2,3,4)/q+1;/p-1
- Synonyms:
- 2,4,6-Triphenylpyranium Hydrogen Sulfate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2,4,6-Triphenylpyrylium Hydrogensulfate REF: 3B-T1445CAS: 51071-75-1 | >97.0%(HPLC) | 266.00 € | Wed 09 Apr 25 |
![]() | 2,4,6-Triphenylpyrylium hydrogensulfate REF: IN-DA003FO2CAS: 51071-75-1 | 97% | 134.00 €~242.00 € | Wed 16 Apr 25 |
![]() | 2,4,6-Triphenylpyryliumhydrogensulfate REF: 10-F696076CAS: 51071-75-1 | 97% | To inquire | Mon 28 Apr 25 |
![]() | 2,4,6-Triphenylpyrlium hydrogen sulfate REF: 3D-FT43293CAS: 51071-75-1 | Min. 95% | - - - | Discontinued product |

2,4,6-Triphenylpyrylium Hydrogensulfate
Ref: 3B-T1445
1g | 266.00 € |

2,4,6-Triphenylpyrylium hydrogensulfate
Ref: IN-DA003FO2
1g | 242.00 € | ||
250mg | 134.00 € |

Ref: 10-F696076
1g | To inquire | ||
250mg | To inquire |

2,4,6-Triphenylpyrlium hydrogen sulfate
Ref: 3D-FT43293
1g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |