![N-[(2-Fluorophenyl)methyl]tetrahydro-2-furanmethanamine](https://static.cymitquimica.com/cas-image/407455-n-2-fluorophenyl-methyl-tetrahydro-2-furanmethanamine.png)
CAS 510723-78-1: N-[(2-Fluorophenyl)methyl]tetrahydro-2-furanmethanamine
Description:N-[(2-Fluorophenyl)methyl]tetrahydro-2-furanmethanamine, identified by its CAS number 510723-78-1, is a chemical compound that features a tetrahydrofuran ring, which contributes to its cyclic structure and potential for various interactions. The presence of a fluorophenyl group indicates that it has a fluorine atom substituted on a phenyl ring, which can influence its electronic properties and biological activity. This compound is classified as an amine due to the presence of the amine functional group, which can participate in hydrogen bonding and affect solubility in polar solvents. Its structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to the phenyl and furan moieties can enhance efficacy or selectivity. Additionally, the compound's stereochemistry and functional groups may play a significant role in its reactivity and interactions with biological targets. As with many organic compounds, its stability, solubility, and reactivity will depend on environmental conditions such as pH and temperature.
Formula:C12H16FNO
InChI:InChI=1S/C12H16FNO/c13-12-6-2-1-4-10(12)8-14-9-11-5-3-7-15-11/h1-2,4,6,11,14H,3,5,7-9H2
InChI key:InChIKey=XYXJWOHQMGMWOL-UHFFFAOYSA-N
SMILES:FC=1C=CC=CC1CNCC2OCCC2
- Synonyms:
- [(2-Fluorophenyl)methyl](oxolan-2-ylmethyl)amine
- N-[(2-Fluorophenyl)methyl]tetrahydro-2-furanmethanamine
- N-(2-Fluorobenzyl)-1-(tetrahydrofuran-2-yl)methanamine
- 2-Furanmethanamine, N-[(2-fluorophenyl)methyl]tetrahydro-
- (2-Fluoro-benzyl)-(tetrahydro-furan-2-ylmethyl)-amine
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | [(2-Fluorophenyl)methyl](oxolan-2-ylmethyl)amine REF: 54-PC106208CAS: 510723-78-1 | - - - | 543.00 € | Wed 16 Apr 25 |
 | N-(2-fluorobenzyl)-1-(tetrahydrofuran-2-yl)methanamine REF: 10-F726744CAS: 510723-78-1 | 97% | - - - | Discontinued product |
 | (2-Fluoro-benzyl)-(tetrahydro-furan-2-ylmethyl)-amine REF: 3D-KVA72378CAS: 510723-78-1 | Min. 95% | - - - | Discontinued product |
N-(2-fluorobenzyl)-1-(tetrahydrofuran-2-yl)methanamine
Ref: 10-F726744
| 1g | Discontinued | Request information |
(2-Fluoro-benzyl)-(tetrahydro-furan-2-ylmethyl)-amine
Ref: 3D-KVA72378
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information | |
| 2500mg | Discontinued | Request information |
