CAS 510725-53-8

Piperazine, 1-(2-methylpropyl)-, monohydrochloride

Description:

Piperazine, 1-(2-methylpropyl)-, monohydrochloride is a chemical compound characterized by its piperazine core structure, which is a six-membered ring containing two nitrogen atoms. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceuticals. It exhibits basic properties due to the presence of nitrogen atoms, allowing it to form salts with acids. The 2-methylpropyl substituent contributes to its unique chemical behavior and potential biological activity. Piperazine derivatives are often studied for their pharmacological properties, including anxiolytic and antidepressant effects. The compound's molecular structure influences its interaction with biological targets, making it of interest in medicinal chemistry. Safety data indicates that, like many piperazine derivatives, it should be handled with care, as it may pose health risks if ingested or improperly managed. Overall, Piperazine, 1-(2-methylpropyl)-, monohydrochloride represents a significant compound in the realm of organic chemistry and drug development.

Formula: C₈H₁₈N₂ClH

InChI: InChI=1S/C8H18N2.ClH/c1-8(2)7-10-5-3-9-4-6-10;/h8-9H,3-7H2,1-2H3;1H

InChI key: FGLSTELVMGHVOW-UHFFFAOYSA-N

SMILES: CC(C)CN1CCNCC1.Cl