CymitQuimica logo

CAS 51075-48-0

:

4-Methyl-1-(1-methylpropyl)piperidine

Description:
4-Methyl-1-(1-methylpropyl)piperidine, with the CAS number 51075-48-0, is a chemical compound belonging to the piperidine class, characterized by a six-membered saturated nitrogen-containing ring. This compound features a methyl group and a branched alkyl substituent (1-methylpropyl) attached to the nitrogen atom of the piperidine ring, which influences its physical and chemical properties. Typically, piperidine derivatives exhibit moderate to high solubility in organic solvents and may have varying degrees of polarity depending on their substituents. The presence of the methyl and isopropyl groups can enhance lipophilicity, potentially affecting the compound's biological activity and interaction with other molecules. Additionally, 4-Methyl-1-(1-methylpropyl)piperidine may exhibit basic properties due to the nitrogen atom, allowing it to participate in protonation reactions. Its structural characteristics suggest potential applications in pharmaceuticals, particularly in the development of compounds with specific biological activities. However, detailed studies on its toxicity, stability, and reactivity are essential for understanding its full chemical profile and potential uses.
Formula:C10H21N
InChI:InChI=1S/C10H21N/c1-4-10(3)11-7-5-9(2)6-8-11/h9-10H,4-8H2,1-3H3
InChI key:InChIKey=ILNCSBVBXKVVDN-UHFFFAOYSA-N
SMILES:C(CC)(C)N1CCC(C)CC1
Synonyms:
  • 1-sec-Butyl-4-methyl-piperidine
  • 4-Methyl-1-(1-methylpropyl)piperidine
  • Piperidine, 4-methyl-1-(1-methylpropyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.