CAS 51076-46-1
:pyridin-4-ylpropanedial
Description:
Pyridin-4-ylpropanedial, with the CAS number 51076-46-1, is an organic compound characterized by its pyridine ring and a propanedial functional group. The structure features a pyridine moiety substituted at the 4-position with a propanedial chain, which includes two aldehyde groups (-CHO) at the terminal ends. This compound typically exhibits a polar nature due to the presence of the aldehyde functional groups, which can participate in hydrogen bonding. Pyridin-4-ylpropanedial may be used in various chemical syntheses and research applications, particularly in the development of pharmaceuticals and agrochemicals. Its reactivity is influenced by the electrophilic nature of the aldehyde groups, making it a potential candidate for condensation reactions and other organic transformations. Additionally, the presence of the pyridine ring can impart unique electronic properties, affecting its behavior in biological systems and interactions with other molecules. Overall, pyridin-4-ylpropanedial is a versatile compound with significant implications in organic chemistry and related fields.
Formula:C8H7NO2
InChI:InChI=1/C8H7NO2/c10-5-8(6-11)7-1-3-9-4-2-7/h1-6,8H
SMILES:c1cnccc1C(C=O)C=O
Synonyms:- 4-Pyridinylmalonaldehyde
- Propanedial, 2-(4-Pyridinyl)-
- Pyridin-4-ylmalonaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(4-Pyridyl)malondialdehyde
CAS:Formula:C8H7NO2Purity:97%Color and Shape:SolidMolecular weight:149.14672-(Pyridin-4-yl)malonaldehyde
CAS:2-(Pyridin-4-yl)malonaldehydeFormula:C8H7NO2Purity:98%Color and Shape: yellow solidMolecular weight:149.15g/mol2-(4-Pyridyl)malondialdehyde
CAS:Formula:C8H7NO2Purity:97%Color and Shape:SolidMolecular weight:149.1492-(4-Pyridyl)malondialdehyde
CAS:2-(4-Pyridyl)malondialdehyde (2-PMAL) is a zwitterionic molecule that is soluble in polar organic solvents. It forms hydrogen bonds with other molecules and has a microporous structure. 2-PMAL has been shown to be an x-ray contrast agent for imaging biological systems. The connectivity of 2-PMAL and the x-ray structure have been determined by single crystal x-ray diffraction studies. The adsorption of 2-PMAL on polymers has been studied experimentally, and its topology has been determined using helical modelling.
2-(4-Pyridyl)malondialdehyde is a compound with both planar and helical structures, which may give it the ability to adsorb onto surfaces or dissolve in water or organic solvents.Formula:C8H7NO2Purity:Min. 95%Molecular weight:149.15 g/mol



