CAS 510764-84-8

1,2,3,4-Tetrahydro-6-methyl-1-oxo-9H-carbazole-9-propanoic acid

Description:

1,2,3,4-Tetrahydro-6-methyl-1-oxo-9H-carbazole-9-propanoic acid, with the CAS number 510764-84-8, is a chemical compound that belongs to the class of carbazole derivatives. This substance features a fused ring structure characteristic of carbazoles, which contributes to its unique chemical properties. The presence of a propanoic acid moiety indicates that it has acidic properties, which may influence its solubility and reactivity in various environments. The tetrahydro configuration suggests that the compound is saturated in certain positions, which can affect its stability and interactions with biological systems. Additionally, the methyl and carbonyl groups present in the structure can enhance its lipophilicity and potential biological activity. Such compounds are often studied for their pharmacological properties, including potential applications in medicinal chemistry. Overall, the specific characteristics of this compound, including its molecular structure and functional groups, play a crucial role in determining its chemical behavior and potential applications in various fields.

Formula: C₁₆H₁₇NO₃

InChI: InChI=1S/C16H17NO3/c1-10-5-6-13-12(9-10)11-3-2-4-14(18)16(11)17(13)8-7-15(19)20/h5-6,9H,2-4,7-8H2,1H3,(H,19,20)

InChI key: InChIKey=SWIWTDIKKNWYEX-UHFFFAOYSA-N

SMILES: C(CC(O)=O)N1C2=C(C=3C1=CC=C(C)C3)CCCC2=O

Synonyms:

• 1,2,3,4-Tetrahydro-6-methyl-1-oxo-9H-carbazole-9-propanoic acid
• 9H-Carbazole-9-propanoic acid, 1,2,3,4-tetrahydro-6-methyl-1-oxo-