CAS 51077-13-5

1-(tert-butoxycarbonyl)-2,5-dihydro-1H-pyrrole-2-carboxylic acid

Description:

1-(tert-Butoxycarbonyl)-2,5-dihydro-1H-pyrrole-2-carboxylic acid, with the CAS number 51077-13-5, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic ring containing nitrogen. This compound features a tert-butoxycarbonyl (Boc) protecting group, commonly used in organic synthesis to protect amines during chemical reactions. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and can be involved in esterification or amidation processes. The dihydropyrrole structure suggests that it is a saturated derivative of pyrrole, which may influence its reactivity and stability. This compound is typically utilized in the synthesis of various pharmaceuticals and biologically active molecules, owing to its ability to serve as an intermediate in the formation of more complex structures. Its solubility and stability can vary depending on the solvent and conditions, making it important to consider these factors during handling and application in synthetic chemistry.

Formula: C₁₀H₁₅NO₄

InChI: InChI=1/C10H15NO4/c1-10(2,3)15-9(14)11-6-4-5-7(11)8(12)13/h4-5,7H,6H2,1-3H3,(H,12,13)

SMILES: CC(C)(C)OC(=O)N1CC=CC1C(=O)O

1-[(tert-butoxy)carbonyl]-2,5-dihydro-1H-pyrrole-2-carboxylic acid

CAS: 51077-13-5

Versatile small molecule scaffold

Formula: C₁₀H₁₅NO₄

Purity: Min. 95%

Molecular weight: 213.2 g/mol

Ref: 3D-BCA07713