CAS 51084-88-9

Ethanone, 2-amino-1-(2,5-dichlorophenyl)-, hydrochloride (1:1)

Description:

Ethanone, 2-amino-1-(2,5-dichlorophenyl)-, hydrochloride (1:1), commonly referred to as a hydrochloride salt, is a chemical compound characterized by its amine and ketone functional groups. It features a dichlorophenyl moiety, which contributes to its potential biological activity and lipophilicity. The presence of the hydrochloride indicates that the compound is in its salt form, which often enhances solubility in water and stability compared to its free base form. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, and it may be investigated for its effects in various therapeutic areas. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. As with any chemical, proper characterization through techniques such as NMR, IR spectroscopy, and mass spectrometry is crucial for confirming its identity and purity in research and industrial applications.

Formula: C₈H₇Cl₂NO·ClH

InChI: InChI=1S/C8H7Cl2NO.ClH/c9-5-1-2-7(10)6(3-5)8(12)4-11;/h1-3H,4,11H2;1H

InChI key: InChIKey=WCAGEUBOVMWNEY-UHFFFAOYSA-N

SMILES: C(CN)(=O)C1=C(Cl)C=CC(Cl)=C1.Cl

Synonyms:

• 2-Amino-1-(2,5-dichlorophenyl)ethanone hydrochloride
• Ethanone, 2-amino-1-(2,5-dichlorophenyl)-, hydrochloride
• Ethanone, 2-amino-1-(2,5-dichlorophenyl)-, hydrochloride (1:1)