CAS 51085-92-8

6-Chloro-4-oxo-4H-1-benzopyran-3-carboxylic acid

Description:

6-Chloro-4-oxo-4H-1-benzopyran-3-carboxylic acid, with the CAS number 51085-92-8, is a chemical compound that belongs to the class of benzopyran derivatives. This substance features a benzopyran core, characterized by a fused benzene and pyran ring, which contributes to its aromatic properties. The presence of a chloro group at the 6-position and a carboxylic acid functional group at the 3-position enhances its reactivity and solubility in polar solvents. The keto group at the 4-position plays a crucial role in stabilizing the compound's structure and may influence its biological activity. This compound is of interest in various fields, including medicinal chemistry and organic synthesis, due to its potential applications in developing pharmaceuticals and agrochemicals. Its unique structural features may also contribute to specific interactions with biological targets, making it a subject of research in drug discovery. As with many chemical substances, safety and handling precautions should be observed, as it may exhibit toxicity or other hazardous properties.

Formula: C₁₀H₅ClO₄

InChI: InChI=1S/C10H5ClO4/c11-5-1-2-8-6(3-5)9(12)7(4-15-8)10(13)14/h1-4H,(H,13,14)

InChI key: InChIKey=ATDTYCFXRNCJHO-UHFFFAOYSA-N

SMILES: O=C1C=2C(OC=C1C(O)=O)=CC=C(Cl)C2

Synonyms:

• 6-Chlorochromone-3-carboxylic acid
• 4H-1-Benzopyran-3-carboxylic acid, 6-chloro-4-oxo-
• 6-Chloro-4-oxo-4H-1-benzopyran-3-carboxylic acid

6-Chlorochromone-3-carboxylic acid

CAS: 51085-92-8

Formula: C₁₀H₅ClO₄

Purity: 97%

Molecular weight: 224.5973

Ref: IN-DA01FE9K

6-Chloro-4-oxo-4H-chromene-3-carboxylic acid

CAS: 51085-92-8

6-Chloro-4-oxo-4H-chromene-3-carboxylic acid

Purity: 95%

Molecular weight: 224.60g/mol

Ref: 54-OR90586