CAS 5109-96-6

2-(pyridin-2-yl)quinoline-4-carbohydrazide

Description:

2-(Pyridin-2-yl)quinoline-4-carbohydrazide, with the CAS number 5109-96-6, is a chemical compound that features a quinoline core substituted with a pyridine group and a carbohydrazide functional group. This compound typically exhibits characteristics such as being a solid at room temperature, with potential applications in medicinal chemistry due to its structural motifs that may interact with biological targets. The presence of both the pyridine and quinoline rings suggests potential for aromatic interactions, which can influence its solubility and reactivity. Additionally, the carbohydrazide moiety may impart properties related to hydrogen bonding and reactivity towards electrophiles. The compound may also exhibit biological activity, making it of interest for further research in pharmacology. Its synthesis often involves multi-step organic reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. Overall, 2-(pyridin-2-yl)quinoline-4-carbohydrazide represents a versatile scaffold in organic and medicinal chemistry.

Formula: C₁₅H₁₂N₄O

InChI: InChI=1/C15H12N4O/c16-19-15(20)11-9-14(13-7-3-4-8-17-13)18-12-6-2-1-5-10(11)12/h1-9H,16H2,(H,19,20)

SMILES: c1ccc2c(c1)c(cc(c1ccccn1)n2)C(=NN)O

Synonyms:

• 2-Pyridin-2-yl-quinoline-4-carboxylic acid hydrazide
• 4-Quinolinecarboxylic acid, 2-(2-pyridinyl)-, hydrazide
• 2-(Pyridin-2-yl)quinoline-4-carbohydrazide
• 2-(2-pyridyl)-4-quinolinecarbohydrazide
• 2-(2-pyridyl)quinoline-4-carbohydrazide
• 2-(2-pyridyl)cinchoninohydrazide