CAS 51094-45-2

[(4-ethoxyphenyl)sulfanyl]acetic acid

Description:

[(4-Ethoxyphenyl)sulfanyl]acetic acid, with the CAS number 51094-45-2, is an organic compound characterized by the presence of a sulfanyl (thioether) functional group attached to an acetic acid moiety. This compound features a 4-ethoxyphenyl group, which contributes to its aromatic character and may influence its solubility and reactivity. The sulfanyl group introduces a sulfur atom, which can participate in various chemical reactions, including nucleophilic substitutions and redox processes. The acetic acid portion of the molecule provides acidic properties, allowing it to participate in acid-base reactions. The overall structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and functional groups that can interact with biological targets. Additionally, the compound's solubility and stability may vary depending on the solvent and environmental conditions, making it important to consider these factors in practical applications.

Formula: C₁₀H₁₂O₃S

InChI: InChI=1/C10H12O3S/c1-2-13-8-3-5-9(6-4-8)14-7-10(11)12/h3-6H,2,7H2,1H3,(H,11,12)

SMILES: CCOc1ccc(cc1)SCC(=O)O

Synonyms:

• [(4-Ethoxyphenyl)Thio]Acetic Acid

2-[(4-Ethoxyphenyl)sulfanyl]acetic acid

CAS: 51094-45-2

Versatile small molecule scaffold

Formula: C₁₀H₁₂O₃S

Purity: Min. 95%

Molecular weight: 212.27 g/mol

Ref: 3D-BCA09445