CAS 51095-85-3

(2S,14bS)-2,12,13-trimethoxy-2,3,5,6,9,10-hexahydro-1H,8H-indolo[7a,1-a][2]benzazepine

Description:

The chemical substance known as (2S,14bS)-2,12,13-trimethoxy-2,3,5,6,9,10-hexahydro-1H,8H-indolo[7a,1-a][2]benzazepine, with the CAS number 51095-85-3, is a complex organic compound characterized by its unique bicyclic structure that incorporates both indole and benzazepine moieties. This compound features multiple methoxy groups, which are known to influence its solubility and reactivity. The stereochemistry indicated by the (2S,14bS) configuration suggests specific spatial arrangements of atoms, which can significantly affect the compound's biological activity and interaction with receptors. Typically, such compounds may exhibit pharmacological properties, potentially acting as neurotransmitter modulators or having other therapeutic effects. The presence of the hexahydro framework indicates saturation in certain rings, contributing to the stability and rigidity of the molecule. Overall, the structural complexity and functional groups present in this compound suggest a diverse range of potential applications in medicinal chemistry and drug development.

Formula: C₂₀H₂₇NO₃

InChI: InChI=1/C20H27NO3/c1-22-16-7-6-15-8-10-21-9-4-5-14-11-18(23-2)19(24-3)12-17(14)20(15,21)13-16/h6,11-12,16H,4-5,7-10,13H2,1-3H3/t16-,20-/m0/s1

SMILES: CO[C@H]1CC=C2CCN3CCCc4cc(c(cc4[C@]23C1)OC)OC

2,7-Dihydrohomoerysotrine

CAS: 51095-85-3

Formula: C₂₀H₂₇NO₃

Purity: 97.5%

Molecular weight: 329.4333

Ref: IN-DA00DGXA

2,7-Dihydrohomoerysotrine

CAS: 51095-85-3

2,7-Dihydrohomoerysotrine possesses cardiodepressant activities on the heart of B. glabrata.

Formula: C₂₀H₂₇NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 329.43

Ref: TM-TN2743

2,7-Dihydrohomoerysotrine

CAS: 51095-85-3

Formula: C₂₀H₂₇NO₃

Purity: 95%~99%

Color and Shape: Oil

Molecular weight: 329.44

Ref: BP-SBP01397

2,7-Dihydrohomoerysotrine

CAS: 51095-85-3

2,7-Dihydrohomoerysotrine is an alkaloid compound, which is a type of naturally occurring chemical typically found in certain plant species. It is primarily sourced from the Erythrina genus, known for its variety of alkaloids exhibiting notable pharmacological properties. 2,7-Dihydrohomoerysotrine interacts with the central nervous system through modulating neuroreceptors, particularly influencing neurotransmitter dynamics. Its mode of action involves binding to specific receptor sites, potentially altering ion channel functions and neurotransmitter release processes.

Formula: C₂₀H₂₇NO₃

Purity: Min. 95%

Molecular weight: 329.4 g/mol

Ref: 3D-BCA09585