CAS 511-05-7: 12-hydroxyabieta-8(14),9(11),12-trien-7-one

Description:12-Hydroxyabieta-8(14),9(11),12-trien-7-one, with the CAS number 511-05-7, is a naturally occurring compound classified as a resin acid, primarily derived from pine tree resins. This compound features a complex polycyclic structure characterized by a bicyclic framework typical of abietane-type compounds. It possesses a hydroxyl group at the 12-position and a ketone functional group at the 7-position, contributing to its reactivity and potential biological activity. The presence of multiple double bonds in its structure indicates that it may exhibit unsaturation, which can influence its chemical behavior and interactions. This compound is of interest in various fields, including organic chemistry and materials science, due to its potential applications in the synthesis of polymers, surfactants, and other chemical derivatives. Additionally, its biological properties may warrant investigation for potential therapeutic uses. Overall, 12-hydroxyabieta-8(14),9(11),12-trien-7-one exemplifies the diverse chemistry of natural products and their relevance in both industrial and medicinal contexts.

Formula:C₂₀H₂₈O₂

InChI:InChI=1S/C20H28O2/c1-12(2)13-9-14-15(10-16(13)21)20(5)8-6-7-19(3,4)18(20)11-17(14)22/h9-10,12,18,21H,6-8,11H2,1-5H3/t18-,20+/m0/s1

InChI key:InChIKey=IPEHJNRNYPOFII-AZUAARDMSA-N

SMILES:O=C1C2=CC(=C(O)C=C2C3(C)CCCC(C)(C)C3C1)C(C)C

Synonyms:
(+)-Sugiol
(4aS,10aS)-2,3,4,4a,10,10a-Hexahydro-6-hydroxy-1,1,4a-trimethyl-7-(1-methylethyl)-9(1H)-phenanthrenone
10-Deoxoxanthoperol
12-Hydroxyabieta-8,11,13-Trien-7-One
9(1H)-Phenanthrenone, 2,3,4,4a,10,10a-hexahydro-6-hydroxy-1,1,4a-trimethyl-7-(1-methylethyl)-, (4aS-trans)-
9(1H)-phenanthrenone, 2,3,4,4a,10,10a-hexahydro-6-hydroxy-1,1,4a-trimethyl-7-(1-methylethyl)-, (4aS,10aS)-
Podocarpa-8,11,13-trien-7-one, 12-hydroxy-13-isopropyl-