
CAS 511-33-1
:Farnesiferol A
Description:
Farnesiferol A, with the CAS number 511-33-1, is a naturally occurring sesquiterpene alcohol primarily derived from various plant sources, particularly those in the Asteraceae family. This compound is characterized by its complex bicyclic structure, which contributes to its unique chemical properties. Farnesiferol A exhibits a range of biological activities, including anti-inflammatory, antimicrobial, and potential anticancer effects, making it of interest in pharmacological research. Its hydrophobic nature allows it to interact with biological membranes, influencing its bioavailability and efficacy. Additionally, Farnesiferol A has been studied for its role in traditional medicine, where it is often associated with various therapeutic applications. The compound's stability and reactivity can be influenced by environmental factors, such as temperature and light, which are important considerations in both natural and synthetic contexts. Overall, Farnesiferol A represents a significant area of study within natural product chemistry, with implications for drug development and therapeutic use.
Formula:C24H30O4
InChI:InChI=1S/C24H30O4/c1-15-5-9-20-23(2,3)21(25)11-12-24(20,4)18(15)14-27-17-8-6-16-7-10-22(26)28-19(16)13-17/h6-8,10,13,18,20-21,25H,1,5,9,11-12,14H2,2-4H3/t18-,20+,21+,24-/m0/s1
InChI key:InChIKey=FCWYNTDTQPCVPG-WTMJVXIESA-N
SMILES:C[C@@]12[C@](CCC(=C)[C@@H]1COC=3C=C4C(=CC3)C=CC(=O)O4)(C(C)(C)[C@H](O)CC2)[H]
Synonyms:- Farnesiferol A
- 7-[[(1S,4aS,6R,8aR)-Decahydro-6-hydroxy-5,5,8a-trimethyl-2-methylene-1-naphthalenyl]methoxy]-2H-1-benzopyran-2-one
- 2H-1-Benzopyran-2-one, 7-[[(1S,4aS,6R,8aR)-decahydro-6-hydroxy-5,5,8a-trimethyl-2-methylene-1-naphthalenyl]methoxy]-
- 2H-1-Benzopyran-2-one, 7-[(decahydro-6-hydroxy-5,5,8a-trimethyl-2-methylene-1-naphthalenyl)methoxy]-, [1S-(1α,4aα,6β,8aβ)]-
- Coumarin, 7-[(1,2,3,4,4aβ,5,6,7,8,8a-decahydro-6α-hydroxy-5,5,8aα-trimethyl-2-methylene-1-naphthyl)methoxy]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Farnesiferol A
CAS:Farnesiferol A is a useful organic compound for research related to life sciences. The catalog number is T124738 and the CAS number is 511-33-1.Formula:C24H30O4Color and Shape:SolidMolecular weight:382.5Farnesiferol A
CAS:Farnesiferol A is a sesquiterpene coumarin compound, primarily isolated from plants of the Ferula genus, notably Ferula farnesiana. As a natural product, it is part of a complex biosynthetic pathway that integrates secondary metabolites found in these plants. The mode of action of Farnesiferol A involves interacting with various cellular and molecular targets due to its unique chemical structure, which enables it to exert biological activities such as anti-inflammatory, antimicrobial, and cytotoxic effects.
Formula:C24H30O4Purity:Min. 95%Molecular weight:382.5 g/mol

