CAS 511-67-1
:5,5-Dibromo-2,4,6(1H,3H,5H)-pyrimidinetrione
Description:
5,5-Dibromo-2,4,6(1H,3H,5H)-pyrimidinetrione, with CAS number 511-67-1, is a heterocyclic organic compound characterized by its pyrimidine ring structure substituted with two bromine atoms at the 5-position and three carbonyl groups at the 2, 4, and 6 positions. This compound typically appears as a crystalline solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. The presence of bromine atoms enhances its reactivity and may influence its solubility in various solvents. The carbonyl groups contribute to its acidity and can participate in various chemical reactions, such as nucleophilic additions. Additionally, the compound may exhibit interesting photophysical properties, making it a subject of study in materials science. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 5,5-Dibromo-2,4,6(1H,3H,5H)-pyrimidinetrione is a versatile compound with significant implications in chemical research and application.
Formula:C4H2Br2N2O3
InChI:InChI=1S/C4H2Br2N2O3/c5-4(6)1(9)7-3(11)8-2(4)10/h(H2,7,8,9,10,11)
InChI key:InChIKey=AMATXUCYHHHHHB-UHFFFAOYSA-N
SMILES:BrC1(Br)C(=O)NC(=O)NC1=O
Synonyms:- 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5,5-dibromo-
- 5,5-Dibromo-2,4,6(1H,3H,5H)-pyrimidinetrione
- 5,5-Dibromopyrimidine-2,4,6-trione
- 5,5-dibromopyrimidine-2,4,6(1H,3H,5H)-trione
- Barbituric acid, 5,5-dibromo-
- Dibromin
- NSC 6206
- 5,5-Dibromobarbituric acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5,5-Dibromobarbituric Acid
CAS:Controlled ProductStability Moisture Sensitive
Applications 5,5-Dibromobarbituric Acid (cas# 511-67-1) is a useful research chemical.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C4H2Br2N2O3Color and Shape:NeatMolecular weight:285.885,5-Dibromobarbituric acid
CAS:Controlled Product5,5-Dibromobarbituric acid is a chemical cross-linker that is used to immobilize proteins and cells. It has been shown to be a potent inhibitor of ovary function, reducing fertility, and inhibiting cancer cell growth. The use of this chemical in cell culture has been shown to reduce the production of reactive oxygen species and improve metabolic disorders. 5,5-Dibromobarbituric acid is also used as a palladium complex for crosslinking agents in organic synthesis. This compound can be synthesized from methyl ketones with divalent hydrocarbons such as ethylene oxide or propylene oxide. 5,5-Dibromobarbituric acid forms hydrogen bonding interactions with the metal surface.Formula:C4H2Br2N2O3Purity:Min. 95%Molecular weight:285.88 g/mol


