CAS 511-96-6: Gitogenin
Description:Gitogenin is a naturally occurring steroid sapogenin, primarily derived from various plant sources, particularly those in the genus Dioscorea. It is characterized by its steroidal structure, which includes a fused cyclopentanoperhydrophenanthrene core. Gitogenin is known for its potential pharmacological properties, including anti-inflammatory and anti-cancer activities, making it of interest in medicinal chemistry and pharmacognosy. The compound is typically found in the form of a white to off-white crystalline powder and is soluble in organic solvents such as ethanol and chloroform, but has limited solubility in water. Gitogenin can serve as a precursor for the synthesis of various steroidal compounds, including hormones and other bioactive molecules. Its CAS number, 511-96-6, is a unique identifier that facilitates its recognition in chemical databases and literature. As with many steroid derivatives, the biological activity of gitogenin is influenced by its structural modifications, which can enhance its therapeutic potential.
Formula:C27H44O4
InChI:InChI=1S/C27H44O4/c1-15-7-10-27(30-14-15)16(2)24-23(31-27)12-20-18-6-5-17-11-21(28)22(29)13-26(17,4)19(18)8-9-25(20,24)3/h15-24,28-29H,5-14H2,1-4H3/t15-,16+,17+,18-,19+,20+,21-,22-,23+,24+,25+,26+,27-/m1/s1
InChI key:InChIKey=FWCXELAAYFYCSR-RYKNUXCGSA-N
SMILES:OC1CC2CCC3C(CCC4(C)C3CC5OC6(OCC(C)CC6)C(C)C54)C2(C)CC1O
- Synonyms:
- (2α,3β,5α,25R)-Spirostan-2,3-diol
- (25R)-5α-Spirostan-2α,3β-diol
- Spirostan-2,3-diol, (2α,3β,5α,25R)-
- 5α-Spirostan-2α,3β-diol, (25R)-
- Gitogenin
