CAS 511-96-6
:Gitogenin
Description:
Gitogenin is a naturally occurring steroid sapogenin, primarily derived from various plant sources, particularly those in the genus Dioscorea. It is characterized by its steroidal structure, which includes a fused cyclopentanoperhydrophenanthrene core. Gitogenin is known for its potential pharmacological properties, including anti-inflammatory and anti-cancer activities, making it of interest in medicinal chemistry and pharmacognosy. The compound is typically found in the form of a white to off-white crystalline powder and is soluble in organic solvents such as ethanol and chloroform, but has limited solubility in water. Gitogenin can serve as a precursor for the synthesis of various steroidal compounds, including hormones and other bioactive molecules. Its CAS number, 511-96-6, is a unique identifier that facilitates its recognition in chemical databases and literature. As with many steroid derivatives, the biological activity of gitogenin is influenced by its structural modifications, which can enhance its therapeutic potential.
Formula:C27H44O4
InChI:InChI=1S/C27H44O4/c1-15-7-10-27(30-14-15)16(2)24-23(31-27)12-20-18-6-5-17-11-21(28)22(29)13-26(17,4)19(18)8-9-25(20,24)3/h15-24,28-29H,5-14H2,1-4H3/t15-,16+,17+,18-,19+,20+,21-,22-,23+,24+,25+,26+,27-/m1/s1
InChI key:InChIKey=FWCXELAAYFYCSR-RYKNUXCGSA-N
SMILES:C[C@@H]1[C@]2(O[C@@]3([C@]1([C@]4(C)[C@@](C3)([C@]5([C@](CC4)([C@]6(C)[C@@](CC5)(C[C@@H](O)[C@H](O)C6)[H])[H])[H])[H])[H])[H])CC[C@@H](C)CO2
Synonyms:- (2α,3β,5α,25R)-Spirostan-2,3-diol
- (25R)-5α-Spirostan-2α,3β-diol
- Spirostan-2,3-diol, (2α,3β,5α,25R)-
- 5α-Spirostan-2α,3β-diol, (25R)-
- Gitogenin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(25R)-5α-SPIROSTAN-2α,3β-DIOL
CAS:Formula:C27H44O4Purity:%Color and Shape:SolidMolecular weight:432.6359Gitogenin
CAS:"Gitogenin, tigogenin, and solasodine selectively inhibit UGT1A4. Gitogenin also stimulates growth hormone release and inhibits α-glucosidase."Formula:C27H44O4Purity:99.72% - 99.73%Color and Shape:SolidMolecular weight:432.64Gitogenin
CAS:Gitogenin is a flavonoid that has been found to have anti-cancer properties. It binds to the estrogen receptor and reduces the expression of genes that are involved in cancer. Gitogenin also inhibits angiogenesis, which is the formation of new blood vessels from pre-existing ones. It has been shown to be effective in treating choroidal neovascularization, a condition where new blood vessels form in the eye's retina, causing vision loss. Gitogenin can be extracted from plants such as St John's wort, grapeseed extract and rice bran. The chemical structure of gitogenin is similar to that of other flavonoids such as quercetin, kaempferol and myricetin. The main difference between these compounds is their hydroxyl group content and number of sugar residues. GITOGENIN is an extract obtained from plants that have been shown to inhibit cancer cells by binding to the estrogen receptor and reducing gene expression associatedFormula:C27H44O4Purity:Min. 95%Color and Shape:PowderMolecular weight:432.64 g/molGitogenin
CAS:Oxygen-heterocyclic compound
Formula:C27H44O4Purity:≥ 90.0 % (HPLC)Molecular weight:432.64Ref: 5G-83855
Discontinued product






