CAS 5110-02-1

6-methyl-2-(pyridin-3-yl)quinoline-4-carboxylic acid

Description:

6-Methyl-2-(pyridin-3-yl)quinoline-4-carboxylic acid is an organic compound characterized by its complex structure, which includes a quinoline core substituted with a methyl group and a pyridine ring. This compound typically exhibits properties associated with heterocyclic aromatic compounds, such as moderate solubility in organic solvents and potential for hydrogen bonding due to the carboxylic acid functional group. The presence of both the quinoline and pyridine moieties suggests that it may exhibit interesting biological activities, potentially acting as a ligand in coordination chemistry or as a precursor in the synthesis of pharmaceuticals. Its carboxylic acid group can participate in acid-base reactions, making it a versatile compound in organic synthesis. Additionally, the compound may show fluorescence properties, which can be useful in various analytical applications. Overall, 6-methyl-2-(pyridin-3-yl)quinoline-4-carboxylic acid is a valuable compound in both research and industrial contexts, particularly in medicinal chemistry and materials science.

Formula: C₁₆H₁₂N₂O₂

InChI: InChI=1/C16H12N2O2/c1-10-4-5-14-12(7-10)13(16(19)20)8-15(18-14)11-3-2-6-17-9-11/h2-9H,1H3,(H,19,20)

InChI key: YVJIAXLVVRQUJP-UHFFFAOYSA-N

SMILES: Cc1ccc2c(c1)c(cc(c1cccnc1)n2)C(=O)O

Synonyms:

• 4-Quinolinecarboxylic Acid, 6-Methyl-2-(3-Pyridinyl)-