CAS 51105-90-9

methyl 1H-pyrazole-4-carboxylate

Description:

Methyl 1H-pyrazole-4-carboxylate is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a carboxylate functional group, contributing to its acidic properties, and a methyl ester group, which enhances its solubility in organic solvents. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. Methyl 1H-pyrazole-4-carboxylate is known for its applications in medicinal chemistry, particularly in the synthesis of various bioactive compounds, including pharmaceuticals and agrochemicals. Its reactivity is influenced by the presence of the carboxylate group, allowing for various chemical transformations, such as esterification and nucleophilic substitutions. Additionally, it may exhibit biological activity, making it a subject of interest in research related to drug development. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate safety measures to avoid exposure.

Formula: C₅H₆N₂O₂

InChI: InChI=1/C5H6N2O2/c1-9-5(8)4-2-6-7-3-4/h2-3H,1H3,(H,6,7)

SMILES: COC(=O)c1c[nH]nc1

Synonyms:

• 1H-pyrazole-4-carboxylic acid methyl ester

METHYL 1H-PYRAZOLE-4-CARBOXYLATE

CAS: 51105-90-9

Formula: C₅H₆N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 126.1133

Ref: IN-DA00D9YE

Methyl 1H-pyrazole-4-carboxylate

CAS: 51105-90-9

Methyl 1H-pyrazole-4-carboxylate

Formula: C₅H₆N₂O₂

Purity: 97%

Color and Shape: faint yellow solid

Molecular weight: 126.11g/mol

Ref: 54-OR30826

Methyl 1H-pyrazole-4-carboxylate

CAS: 51105-90-9

Formula: C₅H₆N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 126.115

Ref: 10-F214924