CymitQuimica logo

CAS 51105-90-9

:

methyl 1H-pyrazole-4-carboxylate

Description:
Methyl 1H-pyrazole-4-carboxylate is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a carboxylate functional group, contributing to its acidic properties, and a methyl ester group, which enhances its solubility in organic solvents. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. Methyl 1H-pyrazole-4-carboxylate is known for its applications in medicinal chemistry, particularly in the synthesis of various bioactive compounds, including pharmaceuticals and agrochemicals. Its reactivity is influenced by the presence of the carboxylate group, allowing for various chemical transformations, such as esterification and nucleophilic substitutions. Additionally, it may exhibit biological activity, making it a subject of interest in research related to drug development. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate safety measures to avoid exposure.
Formula:C5H6N2O2
InChI:InChI=1/C5H6N2O2/c1-9-5(8)4-2-6-7-3-4/h2-3H,1H3,(H,6,7)
InChI key:VFTZKSMAJVLWOV-UHFFFAOYSA-N
SMILES:COC(=O)c1c[nH]nc1
Synonyms:
  • 1H-pyrazole-4-carboxylic acid methyl ester
Found 4 products.