CAS 5111-73-9
:1,4-dihydronaphthalene-1-carboxylic acid
Description:
1,4-Dihydronaphthalene-1-carboxylic acid, with the CAS number 5111-73-9, is an organic compound characterized by its naphthalene structure, which consists of two fused benzene rings. This compound features a carboxylic acid functional group (-COOH) attached to one of the carbon atoms in the naphthalene system, specifically at the 1-position, while the 4-position is saturated with two hydrogen atoms, resulting in a dihydro derivative. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. 1,4-Dihydronaphthalene-1-carboxylic acid is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its derivatives and related compounds are of interest in organic synthesis and materials science, particularly in the development of pharmaceuticals and agrochemicals. As with many organic compounds, handling should be done with care, considering potential reactivity and safety protocols.
Formula:C11H10O2
InChI:InChI=1/C11H10O2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h1-4,6-7,10H,5H2,(H,12,13)
SMILES:c1ccc2c(c1)CC=CC2C(=O)O
Synonyms:- 1-Naphthalenecarboxylic acid, 1,4-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
