CAS 51110-60-2

2-methyl-1,3-benzoxazol-4-ol

Description:

2-Methyl-1,3-benzoxazol-4-ol, with the CAS number 51110-60-2, is an organic compound characterized by its heterocyclic structure, which includes a benzene ring fused to an oxazole moiety. This compound features a hydroxyl group (-OH) at the 4-position and a methyl group (-CH3) at the 2-position of the benzoxazole ring. It is typically a white to off-white solid and is soluble in polar organic solvents. The presence of the hydroxyl group contributes to its potential as a weak acid, allowing it to participate in hydrogen bonding, which can influence its solubility and reactivity. 2-Methyl-1,3-benzoxazol-4-ol is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in the synthesis of other chemical compounds. Its properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions, making it essential to refer to specific data for precise applications.

Formula: C₈H₇NO₂

InChI: InChI=1/C8H7NO2/c1-5-9-8-6(10)3-2-4-7(8)11-5/h2-4,10H,1H3

SMILES: Cc1nc2c(cccc2o1)O

Synonyms:

• 2-Methyl-4-hydroxybenzoxazole
• 4-Benzoxazolol, 2-Methyl-
• 2-Methyl-1,3-benzoxazol-4-ol

4-Hydroxy-2-methylbenzo[d]oxazole

CAS: 51110-60-2

Formula: C₈H₇NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 149.1467

Ref: IN-DA01AG3C

2-Methylbenzo[d]oxazol-4-ol

CAS: 51110-60-2

2-Methylbenzo[d]oxazol-4-ol

Purity: 98%

Molecular weight: 149.15g/mol

Ref: 54-OR88076

2-Methylbenzo[d]oxazol-4-ol

CAS: 51110-60-2

Purity: 98%

Molecular weight: 149.1490021

Ref: 10-F617562

2-Methyl-1,3-benzoxazol-4-ol

CAS: 51110-60-2

2-Methyl-1,3-benzoxazol-4-ol is a planar torsion with a chloride. The crystal structure of 2-Methyl-1,3-benzoxazol-4-ol has been solved by XRD and the molecular weight was found to be 253.2 g/mol. The chemical formula for 2-Methyl-1,3-benzoxazol-4-ol is C11H12ClNO2.
The benzoxazole ring in 2 methyl 1,3 benzoxazole 4 ol is planar and contains two methyl groups on the 4 position. This molecule can exist as either cis or trans form depending on the geometry of the molecule. The cis form has two hydrogen atoms on the opposite side of the molecule to each other whereas in trans it has only one hydrogen atom on opposite sides of the molecule. These two forms are not interchangeable and have different physical properties such as

Formula: C₈H₇NO₂

Purity: Min. 95%

Molecular weight: 149.15 g/mol

Ref: 3D-BCA11060