CAS 5112-65-2

[4-(trimethylsilyl)phenyl]acetic acid

Description:

[4-(Trimethylsilyl)phenyl]acetic acid, with the CAS number 5112-65-2, is an organic compound characterized by the presence of a phenyl group substituted with a trimethylsilyl group and an acetic acid functional group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents such as dichloromethane and ethyl acetate, while being less soluble in water due to its hydrophobic trimethylsilyl moiety. The trimethylsilyl group enhances the compound's stability and volatility, making it useful in various synthetic applications, particularly in organic synthesis and as a protecting group in chemical reactions. The presence of the acetic acid functional group contributes to its acidic properties, allowing it to participate in acid-base reactions. Additionally, this compound may exhibit interesting reactivity patterns due to the electronic effects of the trimethylsilyl group, which can influence the behavior of the phenyl ring in electrophilic aromatic substitution reactions. Overall, [4-(trimethylsilyl)phenyl]acetic acid is a versatile compound with applications in both research and industrial chemistry.

Formula: C₁₁H₁₆O₂Si

InChI: InChI=1/C11H16O2Si/c1-14(2,3)10-6-4-9(5-7-10)8-11(12)13/h4-7H,8H2,1-3H3,(H,12,13)

SMILES: C[Si](C)(C)c1ccc(cc1)CC(=O)O

2-[4-(Trimethylsilyl)phenyl]acetic acid

CAS: 5112-65-2

Versatile small molecule scaffold

Formula: C₁₁H₁₆O₂Si

Purity: Min. 95%

Molecular weight: 208.33 g/mol

Ref: 3D-FAA11265