CymitQuimica logo

CAS 511237-54-0

:

(4-methylpiperidin-1-yl)acetic acid

Description:
(4-Methylpiperidin-1-yl)acetic acid is an organic compound characterized by its piperidine ring structure, which includes a methyl group at the 4-position and an acetic acid functional group. This compound features a nitrogen atom in the piperidine ring, contributing to its basicity and potential for forming hydrogen bonds. The presence of the acetic acid moiety imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Its molecular structure suggests it may exhibit solubility in polar solvents due to the presence of both hydrophobic (the piperidine ring) and hydrophilic (the carboxylic acid group) regions. This dual nature can influence its behavior in biological systems, potentially affecting its pharmacokinetics and interactions with biological targets. Additionally, the compound may serve as a building block in the synthesis of pharmaceuticals or other chemical entities, given its functional groups and structural features. Overall, (4-methylpiperidin-1-yl)acetic acid is a versatile compound with applications in medicinal chemistry and organic synthesis.
Formula:C8H15NO2
InChI:InChI=1/C8H15NO2/c1-7-2-4-9(5-3-7)6-8(10)11/h7H,2-6H2,1H3,(H,10,11)
InChI key:AVZSMACEWPTTTE-UHFFFAOYSA-N
SMILES:CC1CCN(CC1)CC(=O)O
Synonyms:
  • 1-Piperidineacetic acid, 4-methyl-
  • (4-Methylpiperidin-1-yl)acetic acid
Found 3 products.