CAS 511237-62-0

1-Propanol, 3-[[1-(4-pyridinyl)ethyl]amino]-

Description:

1-Propanol, 3-[[1-(4-pyridinyl)ethyl]amino]- is a chemical compound characterized by its structure, which includes a propanol group and a pyridine moiety. This compound features a propanol backbone with an amino group attached to a 1-(4-pyridinyl)ethyl substituent, indicating it has both alcohol and amine functional groups. The presence of the pyridine ring suggests potential for aromatic interactions, which may influence its solubility and reactivity. Typically, such compounds exhibit moderate polarity due to the hydroxyl group, allowing for hydrogen bonding, which can affect their boiling and melting points. The compound may also demonstrate biological activity, as many pyridine-containing compounds are known for their pharmacological properties. Its CAS number, 511237-62-0, allows for precise identification in chemical databases. Overall, the characteristics of this compound make it of interest in various fields, including medicinal chemistry and materials science, where its unique functional groups can be leveraged for specific applications.

Formula: C₁₀H₁₆N₂O

InChI: InChI=1S/C10H16N2O/c1-9(12-5-2-8-13)10-3-6-11-7-4-10/h3-4,6-7,9,12-13H,2,5,8H2,1H3

InChI key: InChIKey=FDCRRSIBJZPFKU-UHFFFAOYSA-N

SMILES: C(NCCCO)(C)C=1C=CN=CC1

Synonyms:

• 3-[[1-(Pyridin-4-yl)ethyl]amino]propan-1-ol
• 1-Propanol, 3-[[1-(4-pyridinyl)ethyl]amino]-