CAS 511237-63-1
:N-(3-Methoxypropyl)-3-pyridinemethanamine
Description:
N-(3-Methoxypropyl)-3-pyridinemethanamine, identified by its CAS number 511237-63-1, is an organic compound characterized by its pyridine ring and an amine functional group. This compound features a methoxypropyl substituent, which contributes to its solubility and potential biological activity. Typically, compounds of this nature exhibit moderate polarity due to the presence of both hydrophobic (the aromatic pyridine) and hydrophilic (the amine and methoxy groups) components. The amine group can participate in hydrogen bonding, influencing its reactivity and interactions with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with various biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and its properties can be further explored through spectroscopic methods. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and reactivity.
Formula:C10H16N2O
InChI:InChI=1S/C10H16N2O/c1-13-7-3-6-12-9-10-4-2-5-11-8-10/h2,4-5,8,12H,3,6-7,9H2,1H3
InChI key:InChIKey=JLQSEDOFFGXCFC-UHFFFAOYSA-N
SMILES:C(NCCCOC)C=1C=CC=NC1
Synonyms:- 3-Pyridinemethanamine, N-(3-methoxypropyl)-
- N-(3-Methoxypropyl)-3-pyridinemethanamine
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery