CAS 51135-96-7
:4-(Phenylmethyl)-4-piperidinol
Description:
4-(Phenylmethyl)-4-piperidinol, also known by its CAS number 51135-96-7, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a phenylmethyl group attached to the piperidine nitrogen, contributing to its unique properties. It is typically a white to off-white solid at room temperature and is soluble in organic solvents such as ethanol and chloroform, but may have limited solubility in water. The presence of the hydroxyl group (-OH) in its structure indicates that it can participate in hydrogen bonding, which can influence its reactivity and interactions with other molecules. 4-(Phenylmethyl)-4-piperidinol is of interest in medicinal chemistry and pharmacology due to its potential biological activities, including effects on the central nervous system. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any health risks associated with exposure.
Formula:C12H17NO
InChI:InChI=1S/C12H17NO/c14-12(6-8-13-9-7-12)10-11-4-2-1-3-5-11/h1-5,13-14H,6-10H2
InChI key:InChIKey=KJZBZOFESQSBCV-UHFFFAOYSA-N
SMILES:C(C1(O)CCNCC1)C2=CC=CC=C2
Synonyms:- 4-(Phenylmethyl)-4-piperidinol
- 4-Benzyl-4-Hydroxypiperidinium
- 4-Benzyl-4-piperidinol
- 4-Benzylpiperidin-4-Ol
- 4-Hydroxy-4-benzylpiperidine
- 4-Hydroxy-4-phenylmethylpiperidine
- 4-Piperidinol, 4-(phenylmethyl)-
- NSC 83237
- 4-Benzyl-4-hydroxypiperidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Benzyl-4-hydroxypiperidine, 97%
CAS:It is a building block used for the synthesis of various compounds, having therapeutic properties, such as synthesis of 4-Benzimidazolyl-piperidinylcarbonyl-piperidine analogs as histamine H3 antagonists. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product poFormula:C12H18NOPurity:97%Color and Shape:White to cream, Crystals or powder or crystalline powderMolecular weight:192.284-Benzyl-4-hydroxypiperidine
CAS:4-Benzyl-4-hydroxypiperidinePurity:97%Color and Shape:Yellow SolidMolecular weight:191.27g/mol4-Benzyl-4-piperidinol
CAS:Controlled ProductApplications 4-Benzyl-4-piperidinol, is a building block used for the synthesis of various compounds, having therapeutic properties, such as synthesis of 4-Benzimidazolyl-piperidinylcarbonyl-piperidine analogs as histamine H3 antagonists.
References Ting, P. C., et al.: Bioorg. Med. Chem. Lett., 20, 5004 (2010);Formula:C12H17NOColor and Shape:NeatMolecular weight:191.27




