CymitQuimica logo

CAS 51141-40-3

:

Dermostatin B

Description:
Dermostatin B is a bioactive compound classified as a cyclic peptide, primarily known for its presence in certain marine organisms, particularly in the skin of amphibians. It exhibits a range of biological activities, including antimicrobial and antifungal properties, making it of interest in pharmaceutical and biomedical research. The molecular structure of Dermostatin B features a unique cyclic arrangement that contributes to its stability and biological function. Its mechanism of action often involves interaction with cellular membranes, leading to disruption of microbial integrity. Additionally, Dermostatin B has been studied for potential applications in wound healing and as a natural preservative due to its ability to inhibit the growth of pathogenic microorganisms. Research continues to explore its full potential, including its efficacy and safety in various applications. As with many natural products, the extraction and synthesis of Dermostatin B can present challenges, but advancements in chemical methodologies are paving the way for its broader utilization in health and industry.
Formula:C41H66O11
InChI:InChI=1/C41H66O11/c1-5-28(2)41-29(3)19-20-31(42)21-32(43)22-33(44)23-34(45)24-35(46)25-36(47)26-37(48)27-39(50)30(4)38(49)17-15-13-11-9-7-6-8-10-12-14-16-18-40(51)52-41/h6-16,18-20,28-39,41-50H,5,17,21-27H2,1-4H3/t28-,29-,30-,31-,32-,33-,34+,35-,36+,37+,38-,39+,41-/m0/s1
Synonyms:
  • Oxacyclohexatriaconta-3,5,7,9,11,13,33-heptaen-2-one, 16,18,20,22,24,26,28,30,32-nonahydroxy-17,35-dimethyl-36-[(1S)-1-methylpropyl]-, (3E,5E,7E,9E,11E,13E,16S,17S,18R,20R,22R,24S,26S,28R,30R,32R,33E,35S,36S)-
  • (15S,16S,17R,19R,21R,23S,25S,27R,29R,31R,34S,35S,36S)-37-Methyldermostatin A
  • Dermostatin B
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Dermostatin B

    CAS:
    <p>Dermostatin B is a polyene antibiotic with antifungal properties, suitable for research on fungal infections.</p>
    Formula:C41H66O11
    Color and Shape:Solid
    Molecular weight:734.956