CymitQuimica logo

CAS 51144-95-7

:

1-[(2-nitrophenyl)sulfonyl]-1H-pyrrole

Description:
1-[(2-Nitrophenyl)sulfonyl]-1H-pyrrole is an organic compound characterized by its unique structure, which includes a pyrrole ring substituted with a sulfonyl group attached to a 2-nitrophenyl moiety. This compound typically exhibits a yellow to orange color due to the presence of the nitro group, which can also influence its electronic properties. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The sulfonyl group enhances its reactivity, making it a useful building block in the development of more complex molecules. Additionally, the presence of the nitro group can impart specific chemical reactivity, such as electrophilic substitution. The compound is likely to be soluble in polar organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C10H8N2O4S
InChI:InChI=1/C10H8N2O4S/c13-12(14)9-5-1-2-6-10(9)17(15,16)11-7-3-4-8-11/h1-8H
SMILES:c1ccc(c(c1)N(=O)=O)S(=O)(=O)n1cccc1
Synonyms:
  • 1H-Pyrrole, 1-((2-nitrophenyl)sulfonyl)-
  • 1-((2-Nitrophenyl)sulfonyl)-1H-pyrrole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • 1-[(2-Nitrophenyl)sulfonyl]-1H-pyrrole

    Controlled Product
    CAS:

    Applications 1-[(2-Nitrophenyl)sulfonyl]-1H-pyrrole is used in the preparation of various 2-​substituted N-​nosylpyrroles.
    References Shibata, M. et al. Tetrahedron. 71, 4495 (2015);

    Formula:C10H8N2O4S
    Color and Shape:Neat
    Molecular weight:252.246

    Ref: TR-N926253

    250mg
    1,022.00€