CAS 51146-07-7

Methyl 1,2-dihydro-5,6-dimethyl-2-oxo-3-pyridinecarboxylate

Description:

Methyl 1,2-dihydro-5,6-dimethyl-2-oxo-3-pyridinecarboxylate, with the CAS number 51146-07-7, is a chemical compound that belongs to the class of pyridine derivatives. It features a pyridine ring substituted with methyl groups and a carboxylate functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the keto group enhances its electrophilic character, making it useful in various chemical reactions, including condensation and substitution reactions. This compound is typically characterized by its molecular structure, which includes a dihydro-pyridine framework, and exhibits properties such as solubility in organic solvents. Its derivatives may have biological activity, making it of interest in medicinal chemistry. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, Methyl 1,2-dihydro-5,6-dimethyl-2-oxo-3-pyridinecarboxylate is a versatile compound with applications in research and industry.

Formula: C₉H₁₁NO₃

InChI: InChI=1S/C9H11NO3/c1-5-4-7(9(12)13-3)8(11)10-6(5)2/h4H,1-3H3,(H,10,11)

InChI key: InChIKey=XBSQZZZYHYOHHW-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C(=O)NC(C)=C(C)C1

Synonyms:

• 3-Pyridinecarboxylic acid, 1,2-dihydro-5,6-dimethyl-2-oxo-, methyl ester
• Methyl 1,2-dihydro-5,6-dimethyl-2-oxo-3-pyridinecarboxylate