CymitQuimica logo

CAS 511540-64-0

:

5-[(4-Bromo-2,6-difluorophenyl)difluoromethoxy]-1,2,3-trifluorobenzene

Description:
5-[(4-Bromo-2,6-difluorophenyl)difluoromethoxy]-1,2,3-trifluorobenzene, with the CAS number 511540-64-0, is a synthetic organic compound characterized by its complex fluorinated aromatic structure. This compound features multiple fluorine substituents, which significantly influence its chemical properties, including increased lipophilicity and potential bioactivity. The presence of the bromine atom adds to its reactivity and may enhance its interactions in biological systems. The difluoromethoxy group contributes to its overall stability and solubility in organic solvents. Due to its unique structure, this compound may exhibit interesting electronic properties and could be of interest in various fields, including medicinal chemistry and materials science. Its synthesis typically involves advanced organic reactions, and it may serve as a building block for more complex molecules or as a potential candidate for pharmaceutical applications. However, specific safety and handling guidelines should be followed due to the presence of halogenated compounds, which can pose environmental and health risks.
Formula:C13H4BrF7O
InChI:InChI=1S/C13H4BrF7O/c14-5-1-7(15)11(8(16)2-5)13(20,21)22-6-3-9(17)12(19)10(18)4-6/h1-4H
InChI key:InChIKey=SHRYZLBRADLPQN-UHFFFAOYSA-N
SMILES:C(OC1=CC(F)=C(F)C(F)=C1)(F)(F)C2=C(F)C=C(Br)C=C2F
Synonyms:
  • 5-((4-Bromo-2,6-Difluorophenyl)Difluoromethoxy)-1,2,3-Trifluorobenzene
  • Benzene, 5-[(4-bromo-2,6-difluorophenyl)difluoromethoxy]-1,2,3-trifluoro-
Found 5 products.