CAS 5116-24-5: 5-Hydroxymethyl-2′-deoxyuridine
Description:5-Hydroxymethyl-2′-deoxyuridine (HMdU) is a nucleoside analog of deoxyuridine, characterized by the presence of a hydroxymethyl group at the 5-position of the uracil base. Its chemical formula is C10H13N2O5, and it has a molecular weight of approximately 241.23 g/mol. HMdU is notable for its role in biochemical research, particularly in studies related to DNA synthesis and repair mechanisms. It can be incorporated into DNA during replication, potentially affecting the stability and function of the genetic material. The compound is often used in the context of studying the effects of modified nucleosides on cellular processes and has implications in cancer research and antiviral therapies. HMdU is typically soluble in water and exhibits moderate stability under physiological conditions. Its CAS number, 5116-24-5, is a unique identifier that facilitates its recognition in scientific literature and databases. Overall, HMdU serves as a valuable tool in molecular biology and medicinal chemistry for understanding nucleic acid behavior and interactions.
Formula:C10H14N2O6
InChI:InChI=1S/C10H14N2O6/c13-3-5-2-12(10(17)11-9(5)16)8-1-6(15)7(4-14)18-8/h2,6-8,13-15H,1,3-4H2,(H,11,16,17)/t6-,7+,8+/m0/s1
InChI key:InChIKey=IPAVKOYJGUMINP-XLPZGREQSA-N
SMILES:O=C1NC(=O)N(C=C1CO)C2OC(CO)C(O)C2
- Synonyms:
- 1-(2-deoxypentofuranosyl)-5-(hydroxymethyl)pyrimidine-2,4(1H,3H)-dione
- 2'-Deoxy-5-(Hydroxymethyl)Uridine
- 2′-Desoxy-5-hydroxymethyluridine
- 5-(Hydroxymethyl)-2′-desoxyuridine
- 5-Hydroxymethyldeoxyuridine
- Thymidine, α-hydroxy-
- Uridine, 2′-deoxy-5-(hydroxymethyl)-
- α-Hydroxythymidine
- 5-Hydroxymethyl-2′-deoxyuridine
