CAS 5116-70-1
:N-(4-acetylphenyl)-2-methylbenzamide
Description:
N-(4-acetylphenyl)-2-methylbenzamide, with the CAS number 5116-70-1, is an organic compound characterized by its amide functional group, which is derived from the reaction of an amine with a carboxylic acid. This compound features a phenyl ring substituted with an acetyl group at the para position and a methyl group at the ortho position relative to the amide linkage. Its molecular structure contributes to its potential applications in various fields, including pharmaceuticals and organic synthesis. The presence of both the acetyl and methyl groups can influence its solubility, melting point, and reactivity. Typically, compounds of this nature exhibit moderate to high stability under standard conditions, but their reactivity can vary based on the surrounding environment and functional groups present. Additionally, the compound may exhibit specific biological activities, making it of interest in medicinal chemistry. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly.
Formula:C16H15NO2
InChI:InChI=1/C16H15NO2/c1-11-5-3-4-6-15(11)16(19)17-14-9-7-13(8-10-14)12(2)18/h3-10H,1-2H3,(H,17,19)
SMILES:Cc1ccccc1C(=O)Nc1ccc(cc1)C(=O)C
Synonyms:- benzamide, N-(4-acetylphenyl)-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.