CAS 51165-07-2

L-glutaminyl-L-phenylalanyl-L-phenylalanylglycyl-L-leucyl-L-methioninamide

Description:

L-glutaminyl-L-phenylalanyl-L-phenylalanylglycyl-L-leucyl-L-methioninamide, identified by the CAS number 51165-07-2, is a synthetic peptide composed of six amino acids: glutamine, phenylalanine (two residues), glycine, leucine, and methionine, with an amide group at the terminal end. This compound exhibits characteristics typical of peptides, including the ability to form hydrogen bonds and engage in various interactions due to its polar and non-polar side chains. The presence of aromatic amino acids like phenylalanine contributes to its hydrophobic properties, while glutamine and methionine introduce polar characteristics. Peptides like this one can play roles in biological processes, including signaling and structural functions, and may exhibit specific biological activities depending on their sequence and conformation. Additionally, the amide bond at the terminal end can influence the stability and solubility of the peptide in aqueous environments. Overall, this compound is of interest in biochemical research and potential therapeutic applications.

Formula: C₃₆H₅₂N₈O₇S

InChI: InChI=1/C36H52N8O7S/c1-22(2)18-27(35(50)42-26(32(39)47)16-17-52-3)41-31(46)21-40-34(49)28(19-23-10-6-4-7-11-23)44-36(51)29(20-24-12-8-5-9-13-24)43-33(48)25(37)14-15-30(38)45/h4-13,22,25-29H,14-21,37H2,1-3H3,(H2,38,45)(H2,39,47)(H,40,49)(H,41,46)(H,42,50)(H,43,48)(H,44,51)/t25-,26-,27-,28-,29-/m0/s1

SMILES: CC(C)C[C@@H](C(=N[C@@H](CCSC)C(=N)O)O)N=C(CN=C([C@H](Cc1ccccc1)N=C([C@H](Cc1ccccc1)N=C([C@H](CCC(=N)O)N)O)O)O)O

Synonyms:

• L-methioninamide, L-glutaminyl-L-phenylalanyl-L-phenylalanylglycyl-L-leucyl-
• Substance P (6-11)

Substance P (6-11)

CAS: 51165-07-2

Substance P (6-11) H-Gln-Phe-Phe-Gly-Leu-Met-NH2 is a fatty acid with a molecular weight of 609.82 Da. It is an immune reaction and antinociceptive agent, which also has the ability to stimulate protein synthesis in the central nervous system. Substance P (6-11) H-Gln-Phe-Phe-Gly-Leu-Met-NH2 binds to neurokinin receptor type 1, which is involved in syncytial virus infection and rotarod test.

Formula: C₃₆H₅₂N₈O₇S

Purity: Min. 95%

Molecular weight: 740.91 g/mol

Ref: 3D-FS109599